CAS 60573-88-8
:ibotenic acid monohydrate from amanita sp.
Description:
Ibotenic acid monohydrate, with the CAS number 60573-88-8, is a naturally occurring compound primarily found in certain species of mushrooms, particularly those in the Amanita genus, such as Amanita muscaria. This compound is a neurotoxin and is classified as an amino acid derivative. Ibotenic acid is known for its psychoactive properties, as it acts as a glutamate analog, interacting with glutamate receptors in the brain. In its monohydrate form, it contains one molecule of water per molecule of ibotenic acid, which can influence its solubility and stability. The substance is typically a white crystalline solid and is soluble in water, making it accessible for various analytical and research applications. Due to its psychoactive effects, ibotenic acid has been studied for its potential implications in neuroscience and pharmacology, although it is also associated with toxicity and adverse effects when consumed in significant amounts. Proper handling and caution are advised when working with this compound in laboratory settings.
Formula:C5H6N2O4
InChI:InChI=1/C5H6N2O4/c6-4(5(9)10)2-1-3(8)7-11-2/h1,4H,6H2,(H,7,8)(H,9,10)/t4-/m1/s1
SMILES:c1c([C@H](C(=O)O)N)onc1O
Synonyms:- Ibotenic acid monohydrate Amanita sp.
- Ibotenic acid
- Amino(3-Oxo-2,3-Dihydro-1,2-Oxazol-5-Yl)Acetic Acid Hydrate (1:1)
- (2S)-amino(3-oxo-2,3-dihydroisoxazol-5-yl)ethanoic acid
- (2R)-ammonio(3-oxo-2,3-dihydroisoxazol-5-yl)ethanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ibotenic acid hydrate
CAS:Ibotenic acid hydrate ((RS)-Ibotenic acid hydrate) is an excitatory amino acid receptor agonist, a compound extracted from the Amanita muscaria mushroom.Formula:C5H8N2O5Purity:99.81%Color and Shape:SolidMolecular weight:176.13Ibotenic acid
CAS:M03874 - Ibotenic acid
Formula:C5H6N2O4Purity:95%Color and Shape:SolidMolecular weight:158.113Ibotenic Acid Hydrate
CAS:Controlled ProductFormula:C5H6N2O4·xH2OColor and Shape:NeatMolecular weight:176.127




