CymitQuimica logo

CAS 60588-54-7

:

N-(2,3-Dihydro-3-oxo-1H-pyrazol-4-yl)benzeneacetamide

Description:
N-(2,3-Dihydro-3-oxo-1H-pyrazol-4-yl)benzeneacetamide, with the CAS number 60588-54-7, is a chemical compound that features a pyrazole ring fused with a benzeneacetamide moiety. This compound typically exhibits characteristics such as being a solid at room temperature, with potential applications in medicinal chemistry due to its structural features that may interact with biological targets. The presence of the pyrazole ring suggests potential for biological activity, as pyrazole derivatives are often explored for their pharmacological properties, including anti-inflammatory and analgesic effects. The amide functional group contributes to the compound's solubility and stability, influencing its reactivity and interaction with other molecules. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, N-(2,3-Dihydro-3-oxo-1H-pyrazol-4-yl)benzeneacetamide represents a class of compounds of interest in drug development and chemical research.
Formula:C11H11N3O2
InChI:InChI=1S/C11H11N3O2/c15-10(6-8-4-2-1-3-5-8)13-9-7-12-14-11(9)16/h1-5,7H,6H2,(H,13,15)(H2,12,14,16)
InChI key:InChIKey=VPGNRRWDLDRTSN-UHFFFAOYSA-N
SMILES:N(C(CC1=CC=CC=C1)=O)C=2C(=O)NNC2
Synonyms:
  • N-(2,3-Dihydro-3-oxo-1H-pyrazol-4-yl)benzeneacetamide
  • Benzeneacetamide, N-(2,3-dihydro-3-oxo-1H-pyrazol-4-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.