CymitQuimica logo

CAS 6059-27-4

:

6-(5-bromo-2-hydroxyphenyl)-2-tert-butyl-6a,9a-dichloro-8-(4-fluorophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9(2H,8H)-tetrone

Description:
The chemical substance known as "6-(5-bromo-2-hydroxyphenyl)-2-tert-butyl-6a,9a-dichloro-8-(4-fluorophenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9(2H,8H)-tetrone" with CAS number 6059-27-4 is a complex organic compound characterized by its intricate polycyclic structure. This compound features multiple functional groups, including bromine, chlorine, and fluorine substituents, which contribute to its unique chemical reactivity and potential biological activity. The presence of hydroxyl and tert-butyl groups suggests it may exhibit solubility in organic solvents and possibly some degree of polarity. Its octahydroisoindole framework indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific arrangement of substituents can influence its pharmacokinetic properties, such as absorption and metabolism. Overall, this compound's structural complexity and diverse functional groups make it a subject of interest for further research in various chemical and biological fields.
Formula:C30H26BrCl2FN2O5
InChI:InChI=1/C30H26BrCl2FN2O5/c1-28(2,3)36-24(38)18-10-9-17-20(22(18)25(36)39)13-29(32)26(40)35(16-7-5-15(34)6-8-16)27(41)30(29,33)23(17)19-12-14(31)4-11-21(19)37/h4-9,11-12,18,20,22-23,37H,10,13H2,1-3H3
SMILES:CC(C)(C)N1C(=O)C2CC=C3C(CC4(C(=O)N(c5ccc(cc5)F)C(=O)C4(C3c3cc(ccc3O)Br)Cl)Cl)C2C1=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.