CAS 606-13-3
:Benzoic acid, 2-amino-3-hydroxy-, ethyl ester
Description:
Benzoic acid, 2-amino-3-hydroxy-, ethyl ester, commonly known as ethyl 2-amino-3-hydroxybenzoate, is an organic compound characterized by its ester functional group derived from benzoic acid. It features an amino group (-NH2) and a hydroxyl group (-OH) on the benzene ring, which contribute to its polar nature and potential for hydrogen bonding. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents like ethanol and ether, but less soluble in water due to its hydrophobic aromatic structure. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the amino and hydroxyl groups enhances its reactivity, making it a valuable building block in various chemical reactions. Additionally, it may exhibit biological activity, which could be of interest in medicinal chemistry. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and environmental impact.
Formula:C9H11NO3
InChI:InChI=1S/C9H11NO3/c1-2-13-9(12)6-4-3-5-7(11)8(6)10/h3-5,11H,2,10H2,1H3
InChI key:InChIKey=RNWXEDHFXYFTNM-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(N)C(O)=CC=C1
Synonyms:- Anthranilic acid, 3-hydroxy-, ethyl ester
- Ethyl 2-Amino-3-hydroxybenzoate
- Benzoic acid, 2-amino-3-hydroxy-, ethyl ester
- 2-Amino-3-hydroxybenzoic acid ethyl ester
- Ethyl 3-hydroxyanthranilate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Amino-3-hydroxybenzoic acid ethyl ester
CAS:Formula:C9H11NO3Purity:95%Color and Shape:SolidMolecular weight:181.1885Ethyl 2-amino-3-hydroxybenzoate
CAS:Ethyl 2-amino-3-hydroxybenzoatePurity:95%Molecular weight:181.19g/mol2-Amino-3-hydroxybenzoic acid ethyl ester
CAS:2-Amino-3-hydroxybenzoic acid ethyl ester is soluble in organic solvents and is a catalyst for the hydrolysis of phenoxazinones. It has been shown to be the most active among the amino acid esters at pH 7. The optimum temperature for this enzyme is 37 degrees Celsius. The substrate specificity of this enzyme, which was purified by fractionation, is 3-hydroxyanthranilic acid and 3-hydroxyanthranilic acid with metals such as copper or zinc ions. This enzyme also catalyses the hydrolysis of proteins and peptides containing hydrophobic amino acids.
Formula:C9H11NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:181.19 g/molRef: 3D-FA67660
Discontinued product


