CAS 606-37-1
:1,3-Dinitronaphthalene
Description:
1,3-Dinitronaphthalene is an organic compound characterized by the presence of two nitro groups (-NO2) attached to the naphthalene ring at the 1 and 3 positions. It is a yellow crystalline solid that is sparingly soluble in water but soluble in organic solvents such as acetone and ethanol. This compound is known for its use in the synthesis of dyes and as an intermediate in the production of various chemicals. It exhibits explosive properties, particularly when subjected to heat or shock, making it a compound of interest in both industrial applications and safety considerations. The presence of nitro groups contributes to its reactivity, allowing it to participate in various chemical reactions, including nitration and reduction. Additionally, 1,3-Dinitronaphthalene has been studied for its potential environmental impact, as it can be a pollutant in soil and water systems. Proper handling and storage are essential due to its hazardous nature.
Formula:C10H6N2O4
InChI:InChI=1S/C10H6N2O4/c13-11(14)8-5-7-3-1-2-4-9(7)10(6-8)12(15)16/h1-6H
InChI key:InChIKey=ULALSFRIGPMWRS-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C2=C(C=C(N(=O)=O)C1)C=CC=C2
Synonyms:- 1,3-Dintronaphthalene
- NSC 74478
- Naphthalene, 1,3-dinitro-
- 1,3-Dinitronaphthalene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,3-Dinitronaphthalene 10 µg/mL in Cyclohexane
CAS:Controlled ProductFormula:C10H6N2O4Color and Shape:Single SolutionMolecular weight:218.171,3-Dinitronaphthalene
CAS:1,3-Dinitronaphthalene is a nitrite ion and an aromatic hydrocarbon. It can be prepared by reacting 1,3-dinitrobenzene with sodium nitrite in the presence of concentrated sulfuric acid. It is used as a reagent in chromatographic analysis for the separation of amines and its derivatives. 1,3-Dinitronaphthalene has been shown to react with amines to form covalent adducts which are more polar than the parent compounds. The linear regression analysis of population growth data can be used to estimate parameters such as the rate constant or initial concentration of reactants that might not be directly measurable.
Formula:C10H6N2O4Purity:Min. 95%Molecular weight:218.17 g/mol




