CAS 6060-06-6
:Platanic acid
Description:
Platanic acid, with the CAS number 6060-06-6, is a chemical compound that is primarily known as a colloidal form of platinum. It is characterized by its ability to exist in a stable, dispersed state, which is often utilized in various applications, including catalysis and as a precursor in the synthesis of platinum-based materials. The compound typically exhibits properties associated with platinum, such as high thermal stability and resistance to oxidation. Platanic acid is often used in the preparation of platinum nanoparticles and in electrochemical applications due to its conductive properties. Additionally, it can play a role in organic synthesis and in the development of sensors. Safety considerations should be taken into account when handling platanic acid, as it may pose health risks if inhaled or ingested. Overall, platanic acid is a significant compound in the field of materials science and catalysis, contributing to advancements in various technological applications.
Formula:C29H46O4
InChI:InChI=1S/C29H46O4/c1-17(30)18-9-14-29(24(32)33)16-15-27(5)19(23(18)29)7-8-21-26(4)12-11-22(31)25(2,3)20(26)10-13-28(21,27)6/h18-23,31H,7-16H2,1-6H3,(H,32,33)/t18-,19+,20-,21+,22-,23+,26-,27+,28+,29-/m0/s1
InChI key:InChIKey=RVMPLOSJMIQORE-FUAAEJBOSA-N
SMILES:C(O)(=O)[C@]12[C@@]([C@@]3([C@@](C)(CC1)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)(C(C)(C)[C@@H](O)CC5)[H])[H])[H])([C@H](C(C)=O)CC2)[H]
Synonyms:- Platanic acid
- (3β)-3-Hydroxy-20-oxo-30-norlupan-28-oic acid
- 3aH-Cyclopenta[a]chrysene, 30-norlupan-28-oic acid deriv.
- 30-Norlupan-28-oic acid, 3β-hydroxy-20-oxo-
- 30-Norlupan-28-oic acid, 3-hydroxy-20-oxo-, (3β)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
