CAS 60603-99-8

(3-hydroxy-2-methyl-4-oxopyridin-1(4H)-yl)acetic acid

Description:

(3-Hydroxy-2-methyl-4-oxopyridin-1(4H)-yl)acetic acid, with the CAS number 60603-99-8, is a chemical compound that features a pyridine ring substituted with a hydroxyl group and a ketone, along with an acetic acid moiety. This compound is characterized by its potential biological activity, which may include antimicrobial or anti-inflammatory properties, making it of interest in pharmaceutical research. The presence of the hydroxyl group contributes to its solubility in polar solvents, while the carboxylic acid group can participate in hydrogen bonding and influence its reactivity. The molecular structure suggests that it may engage in various chemical reactions, such as esterification or amidation, due to the functional groups present. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a unique structure that may have applications in medicinal chemistry and related fields.

Formula: C₈H₉NO₄

InChI: InChI=1/C8H9NO4/c1-5-8(13)6(10)2-3-9(5)4-7(11)12/h2-3,13H,4H2,1H3,(H,11,12)

2-(3-Hydroxy-2-methyl-4-oxo-1,4-dihydropyridin-1-yl)acetic acid

CAS: 60603-99-8

Versatile small molecule scaffold

Formula: C₈H₉NO₄

Purity: Min. 95%

Molecular weight: 183.16 g/mol

Ref: 3D-KCA60399