CAS 60611-24-7
:2-fluoro-6-(trifluoromethyl)benzaldehyde
Description:
2-Fluoro-6-(trifluoromethyl)benzaldehyde is an aromatic aldehyde characterized by the presence of a fluorine atom at the 2-position and a trifluoromethyl group at the 6-position of the benzene ring. This compound features a benzaldehyde functional group, which is known for its reactivity in various organic synthesis reactions, particularly in nucleophilic addition and condensation reactions. The presence of the trifluoromethyl group significantly enhances the electron-withdrawing properties of the molecule, influencing its reactivity and stability. Additionally, the fluorine substituents can affect the compound's physical properties, such as boiling and melting points, as well as its solubility in different solvents. 2-Fluoro-6-(trifluoromethyl)benzaldehyde is utilized in the synthesis of various pharmaceuticals and agrochemicals, owing to its unique electronic characteristics and the ability to introduce fluorinated motifs into organic molecules. As with many fluorinated compounds, it may exhibit distinct biological activities and environmental behaviors, necessitating careful handling and assessment in research and industrial applications.
Formula:C8H4F4O
InChI:InChI=1/C8H4F4O/c9-7-3-1-2-6(5(7)4-13)8(10,11)12/h1-4H
SMILES:c1cc(c(C=O)c(c1)F)C(F)(F)F
Synonyms:- alpha,alpha,alpha,6-Tetrafluoro-o-tolualdehyde
- 2-Fluoro-6-trifluoromethylbenzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-fluoro-6-(trifluoromethyl)benzaldehyde
CAS:Formula:C8H4F4OPurity:95%Color and Shape:LiquidMolecular weight:192.11042-Fluoro-6-(trifluoromethyl)benzaldehyde
CAS:2-Fluoro-6-(trifluoromethyl)benzaldehydeFormula:C8H4F4OPurity:97%Color and Shape: clear. light green/light yellow liquidMolecular weight:192.11g/mol2-Fluoro-6-(trifluoromethyl)benzaldehyde
CAS:Formula:C8H4F4OPurity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:192.112-Fluoro-6-(trifluoromethyl)benzaldehyde
CAS:2-Fluoro-6-(trifluoromethyl)benzaldehyde is a chemical compound that is used in the synthesis of other organic compounds. It can be synthesized by reacting benzaldehyde with sodium trifluoromethanesulfinate in liquid ammonia solution at a temperature of -78°C. The reaction produces 2-fluoro-6-(trifluoromethyl)benzaldehyde, which is isolated by evaporating the reaction liquid and recrystallizing the product from methanol. The yield of this reaction is high and there are no major byproducts.
Formula:C8H4F4OPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:192.11 g/mol2-Fluoro-6-(trifluoromethyl)benzaldehyde
CAS:Formula:C8H4F4OPurity:95%Color and Shape:LiquidMolecular weight:192.113




