CAS 60612-88-6

Benzenecarboximidic acid, 3-(trifluoromethyl)-, ethyl ester, hydrochloride (1:1)

Description:

Benzenecarboximidic acid, 3-(trifluoromethyl)-, ethyl ester, hydrochloride (1:1), with CAS number 60612-88-6, is a chemical compound characterized by its structural features that include a benzenecarboximidic acid moiety and a trifluoromethyl group. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydrochloride salt form. The trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical applications. The ethyl ester component contributes to its reactivity and potential for hydrolysis under certain conditions. As a hydrochloride salt, it exhibits improved stability and solubility compared to its free base form. This compound may be utilized in various chemical syntheses and research applications, particularly in the development of agrochemicals or pharmaceuticals, where the trifluoromethyl group is known to impart desirable properties. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₀H₁₀F₃NO·ClH

InChI: InChI=1S/C10H10F3NO.ClH/c1-2-15-9(14)7-4-3-5-8(6-7)10(11,12)13;/h3-6,14H,2H2,1H3;1H

InChI key: InChIKey=KIWWFKXOBBZDRQ-UHFFFAOYSA-N

SMILES: C(OCC)(=N)C1=CC(C(F)(F)F)=CC=C1.Cl

Synonyms:

• Benzenecarboximidic acid, 3-(trifluoromethyl)-, ethyl ester, hydrochloride
• Benzenecarboximidic acid, 3-(trifluoromethyl)-, ethyl ester, hydrochloride (1:1)

ethyl 3-(trifluoromethyl)benzene-1-carboximidate hydrochloride

CAS: 60612-88-6

Formula: C₁₀H₁₁ClF₃NO

Purity: 95.0%

Molecular weight: 253.65

Ref: 10-F522447