
CAS 6063-50-9
:7-{[cyclohexyl(methyl)amino]methyl}-5-(methoxymethyl)quinolin-8-ol
Description:
The chemical substance known as 7-{[cyclohexyl(methyl)amino]methyl}-5-(methoxymethyl)quinolin-8-ol, with the CAS number 6063-50-9, is a quinoline derivative that exhibits a complex molecular structure characterized by the presence of a quinoline core, an amino group, and methoxymethyl substituents. This compound is typically recognized for its potential biological activity, which may include antimicrobial or antitumor properties, making it of interest in medicinal chemistry. The presence of the cyclohexyl group suggests a degree of steric hindrance, which can influence the compound's reactivity and interaction with biological targets. Additionally, the methoxymethyl group may enhance solubility and stability in various solvents. The compound's properties, such as melting point, solubility, and spectral characteristics, would be determined through experimental methods, and its safety profile would need to be assessed for any potential toxicity. Overall, this substance represents a class of compounds that may have significant implications in pharmaceutical research and development.
Formula:C9H9Cl2NO
InChI:InChI=1/C19H26N2O2/c1-21(16-7-4-3-5-8-16)12-14-11-15(13-23-2)17-9-6-10-20-18(17)19(14)22/h6,9-11,16,22H,3-5,7-8,12-13H2,1-2H3
SMILES:CN(Cc1cc(COC)c2cccnc2c1O)C1CCCCC1
Synonyms:- 5-(Methoxymethyl)-7-[(N-cyclohexyl-N-methylamino)methyl]quinolin-8-ol
- 7-([Cyclohexyl(methyl)amino]methyl)-5-(methoxymethyl)-8-quinolinol
- 7-[(Cyclohexyl-methyl-amino)-methyl]-5-methoxymethyl-quinolin-8-ol
- Acetamide, 2,2-dichloro-N-(phenylmethyl)-
- N-benzyl-2,2-dichloroacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
7-(((Cyclohexylmethyl)amino)methyl)-5-(methoxymethyl)quinolin-8-ol
CAS:Formula:C9H9Cl2NOColor and Shape:SolidMolecular weight:218.0799N-Benzyl-2,2-dichloroacetamide
CAS:Controlled ProductApplications N-benzyl-2,2-dichloroacetamide (cas# 6063-50-9) is a useful research chemical.
Formula:C9H9NOCl2Color and Shape:NeatMolecular weight:218.08

