CAS 60632-40-8
:6-Bromovanillin
Description:
6-Bromovanillin is an organic compound that belongs to the class of substituted vanillin derivatives. It is characterized by the presence of a bromine atom at the 6-position of the vanillin structure, which is a phenolic aldehyde. This compound typically appears as a yellow to brown solid and has a distinctive aromatic odor. Its molecular formula is C8H8BrO3, indicating the presence of a bromine atom, three oxygen atoms, and a phenolic hydroxyl group, which contributes to its reactivity and potential applications. 6-Bromovanillin is known for its use in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. It may exhibit biological activity, including antimicrobial and antioxidant properties, making it of interest in medicinal chemistry. Additionally, its solubility in organic solvents and limited solubility in water can influence its applications in different chemical processes. Safety precautions should be taken when handling this compound, as with many brominated organic substances, due to potential toxicity and environmental concerns.
Formula:C8H7BrO3
InChI:InChI=1/C8H7BrO3/c1-12-8-2-5(4-10)6(9)3-7(8)11/h2-4,11H,1H3
SMILES:COc1cc(C=O)c(cc1O)Br
Synonyms:- 2-Bromo-4-hydroxy-5-methoxybenzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Bromo-4-hydroxy-5-methoxybenzaldehyde
CAS:Formula:C8H7BrO3Purity:98%Color and Shape:SolidMolecular weight:231.04342-Bromo-4-hydroxy-5-methoxybenzaldehyde
CAS:2-Bromo-4-hydroxy-5-methoxybenzaldehydePurity:98%Molecular weight:231.04g/mol6-Bromovanillin
CAS:6-Bromovanillin is a biochemical reagent that can be used in the synthesis of caridopa, an aromatic amino acid decarboxylase inhibitor.Formula:C8H7BrO3Purity:99.87%Color and Shape:SolidMolecular weight:231.042-Bromo-4-hydroxy-5-methoxybenzaldehyde
CAS:Formula:C8H7BrO3Purity:95%Color and Shape:SolidMolecular weight:231.0456-Bromovanillin
CAS:6-Bromovanillin is a hydroxymethyl derivative of vanillin that has been shown to react with a number of aldehydes in organic reactions. 6-Bromovanillin can be used as a precursor for the synthesis of piperonal and haplophyllum. In addition, 6-bromovanillin can be decarboxylated to form 4-hydroxybenzoic acid.Formula:C8H7BrO3Purity:Min. 95%Molecular weight:231.04 g/mol





