
CAS 60657-41-2
:Lantanilic acid
Description:
Lantanilic acid, with the CAS number 60657-41-2, is an organic compound that belongs to the class of amino acids. It is characterized by the presence of both an amino group (-NH2) and a carboxylic acid group (-COOH), which are typical functional groups found in amino acids. This compound is notable for its role in various biochemical processes and potential applications in pharmaceuticals and biochemistry. Lantanilic acid may exhibit properties such as solubility in water, depending on its molecular structure and the presence of substituents. Its molecular interactions can influence its behavior in biological systems, making it of interest for research in medicinal chemistry and related fields. Additionally, the compound may participate in various chemical reactions, including peptide bond formation, which is essential for protein synthesis. As with many amino acids, lantanilic acid may also play a role in metabolic pathways and could be involved in the synthesis of other biologically relevant molecules.
Formula:C35H52O6
InChI:InChI=1S/C35H52O6/c1-21(2)17-27(36)41-26-19-29(3,4)18-23-22-9-10-25-32(8,31(22,7)13-15-34(23,26)28(37)38)12-11-24-30(5,6)35(39)16-14-33(24,25)20-40-35/h9,17,23-26,39H,10-16,18-20H2,1-8H3,(H,37,38)/t23-,24-,25-,26+,31+,32+,33+,34-,35-/m0/s1
InChI key:InChIKey=HGMVESCHSMFWDD-ZUQXEZLCSA-N
SMILES:C[C@]12[C@@]([C@]34[C@](C(C)(C)[C@](O)(CC3)OC4)(CC1)[H])(CC=C5[C@@]2(C)CC[C@]6(C(O)=O)[C@]5(CC(C)(C)C[C@H]6OC(C=C(C)C)=O)[H])[H]
Synonyms:- Lantanilic acid
- (3β,22β)-3,25-Epoxy-3-hydroxy-22-[(3-methyl-1-oxo-2-buten-1-yl)oxy]olean-12-en-28-oic acid
- (+)-22β-(3,3-Dimethylacryloyloxy)lantanolic acid
- Olean-12-en-28-oic acid, 3,25-epoxy-3-hydroxy-22-[(3-methyl-1-oxo-2-butenyl)oxy]-, (3β,22β)-
- Olean-12-en-28-oic acid, 3,25-epoxy-3-hydroxy-22-[(3-methyl-1-oxo-2-buten-1-yl)oxy]-, (3β,22β)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Lantanilic acid
CAS:<p>Lantanilic acid is a natural product for research related to life sciences. The catalog number is TN5975 and the CAS number is 60657-41-2.</p>Formula:C35H52O6Purity:98%Color and Shape:SolidMolecular weight:568.795Lantanilic acid
CAS:<p>Lantanilic acid is a chemical compound utilized primarily in the fields of analytical chemistry and dye fabrication. It is derived from the sulfonation of certain organic compounds, providing a stable framework for further chemical reactions. The mode of action of Lantanilic acid involves its ability to act as a reagent in various analytical and industrial processes, facilitating the detection and manipulation of chemical substances.</p>Formula:C35H52O6Purity:Min. 95%Molecular weight:568.8 g/mol

