CAS 6066-46-2

2-Chloro-2,3,3,3-tetrafluoropropanoyl chloride

Description:

2-Chloro-2,3,3,3-tetrafluoropropanoyl chloride, with the CAS number 6066-46-2, is an organofluorine compound characterized by its unique structure that includes both chlorine and fluorine substituents. This compound is typically a colorless to pale yellow liquid, exhibiting a pungent odor. It is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which makes it a potent acylating agent. The fluorinated carbon atoms contribute to its stability and lipophilicity, enhancing its utility in various chemical reactions, including the synthesis of fluorinated compounds. It is soluble in organic solvents but reacts with water, releasing hydrochloric acid and forming corresponding carboxylic acids. Due to its chemical properties, 2-Chloro-2,3,3,3-tetrafluoropropanoyl chloride is used in the production of pharmaceuticals, agrochemicals, and specialty chemicals. However, it must be handled with care due to its corrosive nature and potential environmental impact, necessitating appropriate safety measures during use and disposal.

Formula: C₃Cl₂F₄O

InChI: InChI=1S/C3Cl2F4O/c4-1(10)2(5,6)3(7,8)9

InChI key: InChIKey=UNATUTDSNCSLAP-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(C(Cl)=O)(Cl)F

Synonyms:

• 2-Chlorotetrafluoropropanoyl chloride
• 2-Chlorotetrafluoropropionyl chloride
• Propanoyl Chloride, 2-Chloro-2,3,3,3-Tetrafluoro-
• Propionyl chloride, 2-chloro-2,3,3,3-tetrafluoro-
• 2-Chloro-2,3,3,3-tetrafluoropropanoyl chloride

2-Chlorotetrafluoropropanoyl chloride

CAS: 6066-46-2

2-Chlorotetrafluoropropanoyl chloride

Purity: ≥95%

Molecular weight: 198.93g/mol

Ref: 54-PC4713