CAS 60671-62-7

7-Oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 3-(aminocarbonyl)-, ammonium salt (1:1)

Description:

7-Oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 3-(aminocarbonyl)-, ammonium salt (1:1), with CAS number 60671-62-7, is a bicyclic compound characterized by its unique structural framework that includes a bicyclo[2.2.1]heptene core and an oxabicyclic structure. This compound features a carboxylic acid functional group and an aminocarbonyl substituent, which contribute to its potential reactivity and solubility properties. As an ammonium salt, it exhibits ionic characteristics, enhancing its solubility in polar solvents, which is significant for various applications in organic synthesis and medicinal chemistry. The presence of both acidic and basic functional groups allows for potential interactions in biological systems, making it of interest in pharmaceutical research. Its structural complexity may also influence its physical properties, such as melting point and boiling point, as well as its stability under different conditions. Overall, this compound represents a fascinating example of bicyclic chemistry with potential utility in various chemical and biological contexts.

Formula: C₈H₉NO₄·H₃N

InChI: InChI=1S/C8H9NO4.H3N/c9-7(10)5-3-1-2-4(13-3)6(5)8(11)12;/h1-6H,(H2,9,10)(H,11,12);1H3

InChI key: InChIKey=UTBRKYJEXZKRGY-UHFFFAOYSA-N

SMILES: C(N)(=O)C1C(C(O)=O)C2OC1C=C2.N

Synonyms:

• NSC 191782
• KF 392
• 7-Oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 3-(aminocarbonyl)-, ammonium salt (1:1)
• 7-Oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 3-(aminocarbonyl)-, monoammonium salt

KF 392

CAS: 60671-62-7

KF-392, an antiulcer drug, suppresses Shay ulcer and aspirin/stress/reserpine-induced gastric lesions in rats at 1-5 mg/kg doses orally.

Formula: C₈H₁₂N₂O₄

Color and Shape: Solid

Molecular weight: 200.19

Ref: TM-T25576