
CAS 60671-62-7
:7-Oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 3-(aminocarbonyl)-, ammonium salt (1:1)
Description:
7-Oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 3-(aminocarbonyl)-, ammonium salt (1:1), with CAS number 60671-62-7, is a bicyclic compound characterized by its unique structural framework that includes a bicyclo[2.2.1]heptene core and an oxabicyclic structure. This compound features a carboxylic acid functional group and an aminocarbonyl substituent, which contribute to its potential reactivity and solubility properties. As an ammonium salt, it exhibits ionic characteristics, enhancing its solubility in polar solvents, which is significant for various applications in organic synthesis and medicinal chemistry. The presence of both acidic and basic functional groups allows for potential interactions in biological systems, making it of interest in pharmaceutical research. Its structural complexity may also influence its physical properties, such as melting point and boiling point, as well as its stability under different conditions. Overall, this compound represents a fascinating example of bicyclic chemistry with potential utility in various chemical and biological contexts.
Formula:C8H9NO4·H3N
InChI:InChI=1S/C8H9NO4.H3N/c9-7(10)5-3-1-2-4(13-3)6(5)8(11)12;/h1-6H,(H2,9,10)(H,11,12);1H3
InChI key:InChIKey=UTBRKYJEXZKRGY-UHFFFAOYSA-N
SMILES:C(N)(=O)C1C(C(O)=O)C2OC1C=C2.N
Synonyms:- NSC 191782
- KF 392
- 7-Oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 3-(aminocarbonyl)-, ammonium salt (1:1)
- 7-Oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid, 3-(aminocarbonyl)-, monoammonium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
KF 392
CAS:KF-392, an antiulcer drug, suppresses Shay ulcer and aspirin/stress/reserpine-induced gastric lesions in rats at 1-5 mg/kg doses orally.Formula:C8H12N2O4Color and Shape:SolidMolecular weight:200.19
