CAS 60682-98-6
:Ethyl 4-bromomethylcinnamate
Description:
Ethyl 4-bromomethylcinnamate, with the CAS number 60682-98-6, is an organic compound characterized by its ester functional group and a bromomethyl substituent on a cinnamate structure. It typically appears as a colorless to pale yellow liquid with a pleasant, fruity odor. The compound is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. Ethyl 4-bromomethylcinnamate is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its structure allows for various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in synthetic chemistry. Additionally, the presence of the bromomethyl group enhances its reactivity, facilitating further modifications. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Proper storage in a cool, dry place away from light is recommended to maintain its stability.
Formula:C12H13BrO2
InChI:InChI=1/C12H13BrO2/c1-2-15-12(14)8-7-10-3-5-11(9-13)6-4-10/h3-8H,2,9H2,1H3/b8-7+
Synonyms:- 4-Bromomethylcinnamic acid ethyl ester
- Ethyl 3-(4-bromomethyl)cinnamate
- 3-(4-Brommethyl)-phenylpropenoic acid ethyl ester
- ethyl (2E)-3-[4-(bromomethyl)phenyl]prop-2-enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 4-Bromomethylcinnamate
CAS:Controlled Product<p>Applications Used in the preparation of cinnamamide derivative as 5α-reductase inhibitors.<br>References Mai, A., et al.: J. Med. Chem., et al.: 49, 6046 (2006),<br></p>Formula:C12H13BrO2Color and Shape:NeatMolecular weight:269.134
