CAS 60687-36-7
:(R)-(-)-(1-Aminoethyl)phosphonic acid
Description:
(R)-(-)-(1-Aminoethyl)phosphonic acid, commonly referred to as AEP, is an organophosphorus compound characterized by its amino and phosphonic acid functional groups. It is a chiral molecule, with the (R)-enantiomer being biologically active. AEP is known for its role as a phosphonic acid analogue of amino acids, which allows it to participate in various biochemical processes. The compound is typically a white crystalline solid and is soluble in water, making it suitable for various applications in biological and chemical research. Its structure includes a phosphonic acid group, which imparts unique reactivity and interaction capabilities, particularly in relation to biological systems. AEP has been studied for its potential use in agriculture as a plant growth regulator and in pharmaceuticals for its possible therapeutic effects. Additionally, its ability to mimic amino acids allows it to interfere with metabolic pathways, making it a subject of interest in studies related to enzyme inhibition and metabolic regulation.
Formula:C2H8NO3P
InChI:InChI=1S/C2H8NO3P/c1-2(3)7(4,5)6/h2H,3H2,1H3,(H2,4,5,6)/t2-/m1/s1
InChI key:InChIKey=UIQSKEDQPSEGAU-UWTATZPHSA-N
SMILES:P([C@H](C)N)(=O)(O)O
Synonyms:- (1R)-1-Aminoethylphosphonic acid
- (R)-(-)-(1-Aminoethyl)phosphonic acid
- <span class="text-smallcaps">L</span>-(1-Aminoethyl)phosphonate
- <span class="text-smallcaps">L</span>-1-Aminoethylphosphonic acid
- <span class="text-smallcaps">L</span>-Fosfalin
- P-[(1R)-1-Aminoethyl]phosphonic acid
- Phosphonic acid, (1-aminoethyl)-, (R)-
- Phosphonic acid, P-[(1R)-1-aminoethyl]-
- Phosphonic acid, [(1R)-1-aminoethyl]-
- [(1R)-1-Aminoethyl]phosphonate
- [(1R)-1-Aminoethyl]phosphonic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
R-(-)-1-Aminoethyl phosphonic acid
CAS:<p>R-(-)-1-Aminoethyl phosphonic acid</p>Formula:C2H8NO3PPurity:≥95%Color and Shape: white crystalline powderMolecular weight:125.06g/mol(R)-(-)-1-Aminoethylphosphonic acid
CAS:<p>(R)-(-)-1-Aminoethylphosphonic acid is a versatile building block that can be used to synthesize a variety of useful compounds. It is also used as a reagent in the synthesis of complex compounds and research chemicals. (R)-(-)-1-Aminoethylphosphonic acid is an important intermediate in the synthesis of high quality, useful scaffolds and reaction components. The CAS number for this compound is 60687-36-7.</p>Formula:C2H8NO3PMolecular weight:125.06 g/molRef: 3D-J-100031
Discontinued product

