CAS 6069-98-3
:cis-1-Isopropyl-4-methylcyclohexane
Description:
Cis-1-Isopropyl-4-methylcyclohexane is an organic compound characterized by its cyclohexane ring structure, which features two substituents: an isopropyl group and a methyl group, both positioned on the same side of the ring, hence the "cis" designation. This stereochemistry influences its physical properties, such as boiling and melting points, which are typically affected by the spatial arrangement of the substituents. The compound is a colorless liquid at room temperature and is relatively non-polar, making it soluble in organic solvents but less so in water. Its molecular structure contributes to its stability and reactivity, with potential applications in organic synthesis and as a solvent or intermediate in chemical processes. Additionally, the presence of the isopropyl group can influence the compound's interactions with other molecules, affecting its behavior in various chemical environments. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H20
InChI:InChI=1/C10H20/c1-8(2)10-6-4-9(3)5-7-10/h8-10H,4-7H2,1-3H3/t9-,10+
InChI key:InChIKey=CFJYNSNXFXLKNS-AOOOYVTPNA-N
SMILES:C(C)(C)[C@H]1CC[C@@H](C)CC1
Synonyms:- 1-Isopropyl-cis-4-methylcyclohexane
- 1-Methyl-cis-4-isopropylcyclohexane
- Cyclohexane, 1-methyl-4-(1-methylethyl)-, cis-
- cis-1-Isopropyl-4-methylcyclohexane
- cis-1-Methyl-4-(1-methylethyl)cyclohexane
- cis-p-Menthane
- p-Menthane, cis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
