CAS 607-20-5

6-Hydroxy-1,2-naphthoquinone

Description:

6-Hydroxy-1,2-naphthoquinone, also known as lawsone, is an organic compound characterized by its naphthoquinone structure, which features a hydroxyl group at the 6-position of the naphthalene ring. This compound is typically a yellow to orange solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. It exhibits strong antioxidant properties and is known for its ability to chelate metal ions, which can influence its reactivity and stability. Lawsone is of interest in various fields, including dye chemistry, where it is used as a natural dye, particularly in henna. Additionally, it has been studied for its potential biological activities, including antimicrobial and anticancer properties. The compound's reactivity is largely attributed to the presence of the quinone functional group, which can undergo redox reactions. Overall, 6-Hydroxy-1,2-naphthoquinone is a versatile compound with applications in both industrial and medicinal chemistry.

Formula: C₁₀H₆O₃

InChI: InChI=1S/C10H6O3/c11-7-2-3-8-6(5-7)1-4-9(12)10(8)13/h1-5,11H

InChI key: InChIKey=CQWXLWDPFSPVHK-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC(O)=CC2)C=CC1=O

Synonyms:

• 6-Hydroxy-1,2-naphthoquinone
• 1,2-Naphthoquinone, 6-hydroxy-
• 1,2-Naphthalenedione, 6-hydroxy-
• 6-Hydroxy-1,2-naphthalenedione

6-Hydroxynaphthalene-1,2-dione

CAS: 607-20-5

Versatile small molecule scaffold

Formula: C₁₀H₆O₃

Purity: Min. 95%

Molecular weight: 174.15 g/mol

Ref: 3D-AAA60720