CAS 607-34-1
:5-Nitroquinoline
Description:
5-Nitroquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a nitro group (-NO2) at the 5-position of the quinoline ring significantly influences its chemical properties and reactivity. This compound typically appears as a yellow to orange crystalline solid and is known for its aromatic nature, which contributes to its stability and potential applications in various fields, including pharmaceuticals and agrochemicals. 5-Nitroquinoline is often utilized as an intermediate in the synthesis of other chemical compounds and may exhibit biological activity, making it of interest in medicinal chemistry. Its solubility can vary depending on the solvent, and it may undergo typical reactions associated with nitro compounds, such as reduction or electrophilic substitution. Safety precautions should be observed when handling this substance, as nitro compounds can be hazardous. Overall, 5-Nitroquinoline serves as a valuable compound in both research and industrial applications.
Formula:C9H6N2O2
InChI:InChI=1S/C9H6N2O2/c12-11(13)9-5-1-4-8-7(9)3-2-6-10-8/h1-6H
InChI key:InChIKey=NDDZXHOCOKCNBM-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C2=C(C=CC1)N=CC=C2
Synonyms:- 5-(Hydroxyl[oxido]amino)quinoline
- Brn 0135179
- Nsc 65583
- Quinoline, 5-nitro-
- 5-Nitroquinoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Nitroquinoline
CAS:Formula:C9H6N2O2Purity:>98.0%(GC)(T)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:174.165-Nitroquinoline
CAS:Formula:C9H6N2O2Purity:≥ 98.0%Color and Shape:Yellow powderMolecular weight:174.165-Nitroquinoline
CAS:5-NitroquinolineFormula:C9H6N2O2Purity:≥95%Color and Shape: pale yellow solidMolecular weight:174.16g/mol5-Nitroquinoline
CAS:Formula:C9H6N2O2Purity:95%Color and Shape:Solid, White to yellow powderMolecular weight:174.1595-Nitroquinoline
CAS:5-Nitroquinoline is a nitrogen-containing heterocyclic organic compound. It is a white solid that has a melting point of 104 °C and a boiling point of 212 °C. 5-Nitroquinoline can be synthesized by the addition of sodium carbonate to 6-nitroquinoline in hydrochloric acid. The product is then purified by vacuum distillation and recrystallization from nitric acid and acetic acid. 5-Nitroquinoline can be used as an intermediate in the synthesis of other molecules, such as quinolones, which are used in pharmaceuticals. This compound has been shown to cause metastatic colorectal cancer in mice, but not in human liver cells or human lymphocytes.Formula:C9H6N2O2Purity:Min. 95%Color and Shape:Light (Or Pale) Yellow To Dark Yellow SolidMolecular weight:174.16 g/mol





