CAS 607-60-3
:N-propylnaphthalen-1-amine
Description:
N-propylnaphthalen-1-amine, with the CAS number 607-60-3, is an organic compound characterized by its structure, which consists of a naphthalene ring substituted with an amino group and a propyl group. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its aromatic properties due to the presence of the naphthalene moiety. N-propylnaphthalen-1-amine is often used in various chemical applications, including as an intermediate in the synthesis of dyes, pharmaceuticals, and other organic compounds. Its reactivity is influenced by the amino group, which can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit specific physical properties, such as solubility in organic solvents and varying melting and boiling points, which are important for its handling and application in industrial processes. Safety data should be consulted to understand its toxicity and environmental impact.
Formula:C13H15N
InChI:InChI=1/C13H15N/c1-2-10-14-13-9-5-7-11-6-3-4-8-12(11)13/h3-9,14H,2,10H2,1H3
SMILES:CCCNc1cccc2ccccc12
Synonyms:- 1-Naphthalenamine, N-propyl-
- N-Propylnaphthalen-1-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N-Propylnaphthalen-1-amine
CAS:N-Propylnaphthalen-1-amine is a heterocycle that has two functional groups, fluorescence and photophysical properties. It can be synthesised in nature or synthetically. N-Propylnaphthalen-1-amine is used as an antifungal agent with a mechanism of action that is not yet fully understood. It interacts with the chlorides on the cell wall, which enhances its ability to kill fungi. The constant for this drug is 1×10^5M and the chloride transfer interaction constant is 2×10^2L/mol.
Formula:C13H15NPurity:Min. 95%Molecular weight:185.26 g/mol
