CAS 6071-81-4
:Crambene
Description:
Crambene, with the CAS number 6071-81-4, is a chemical compound classified as a bicyclic monoterpene. It is primarily derived from various plant sources, particularly within the family of Brassicaceae, which includes cruciferous vegetables. Crambene is characterized by its unique structure, featuring a bicyclic framework that contributes to its distinct chemical properties. It is known for its potential biological activities, including antimicrobial and antioxidant properties, which have garnered interest in both food science and pharmacology. The compound is typically colorless to pale yellow and has a characteristic odor. In terms of solubility, crambene is generally soluble in organic solvents but has limited solubility in water. Its reactivity can be influenced by the presence of functional groups, making it a subject of study for various synthetic applications. Overall, crambene represents a fascinating area of research due to its natural occurrence and potential health benefits.
Formula:C5H7NO
InChI:InChI=1S/C5H7NO/c1-2-5(7)3-4-6/h2,5,7H,1,3H2/t5-/m1/s1
InChI key:InChIKey=PBCLOVRWBLGJQA-RXMQYKEDSA-N
SMILES:[C@H](CC#N)(C=C)O
Synonyms:- (3S)-3-Hydroxy-4-pentenenitrile
- (3S)-3-hydroxypent-4-enenitrile
- (S)-1-Cyano-2-hydroxy-3-butene
- 4-Pentenenitrile, 3-Hydroxy-
- 4-Pentenenitrile, 3-hydroxy-, (3S)-
- 4-Pentenenitrile, 3-hydroxy-, (S)-
- Crambene
- NSC 321802
- 3-Hydroxypent-4-enenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
