CAS 6072-49-7

2-thiophen-2-ylbenzoic acid

Description:

2-Thiophen-2-ylbenzoic acid, with the CAS number 6072-49-7, is an organic compound characterized by the presence of both a thiophene ring and a benzoic acid moiety. This compound features a thiophene ring substituted at the 2-position with a benzoic acid group, which contributes to its unique chemical properties. It typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its aromatic nature. The presence of the carboxylic acid functional group imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the thiophene ring can engage in electrophilic aromatic substitution reactions, making this compound versatile in synthetic organic chemistry. Its structural features may also influence its biological activity, potentially making it of interest in pharmaceutical research. Overall, 2-thiophen-2-ylbenzoic acid is a compound of interest due to its unique structural attributes and potential applications in various chemical and biological contexts.

Formula: C₁₁H₈O₂S

InChI: InChI=1/C11H8O2S/c12-11(13)9-5-2-1-4-8(9)10-6-3-7-14-10/h1-7H,(H,12,13)

SMILES: c1ccc(c(c1)c1cccs1)C(=O)O

Synonyms:

• 2-(2-Thienyl)benzoic acid
• Benzoic acid, 2-(2-thienyl)-

2-(thiophen-2-yl)benzoic acid

CAS: 6072-49-7

Formula: C₁₁H₈O₂S

Purity: 97%

Molecular weight: 204.2450

Ref: IN-DA00EBOW

2-(Thien-2-yl)benzoic acid

CAS: 6072-49-7

2-(Thien-2-yl)benzoic acid

Formula: C₁₁H₈O₂S

Purity: 95%

Color and Shape: off-white crystalline solid

Molecular weight: 204.25g/mol

Ref: 54-OR7593

2-(Thiophen-2-yl)benzoic acid

CAS: 6072-49-7

Purity: 97%

Molecular weight: 204.2400055

Ref: 10-F679174

2-Thien-2-ylbenzoic Acid

Controlled Product

CAS: 6072-49-7

Formula: C₁₁H₈O₂S

Color and Shape: Neat

Molecular weight: 626.742

Ref: TR-T344113

2-(Thien-2-yl)benzoic acid

CAS: 6072-49-7

2-(Thien-2-yl)benzoic acid (TBA) is an organic compound. It is a structural analog of thiophene, with the sulfur replaced by a carbon atom. TBA has been shown to have functional groups that are activated by spontaneous reactions and is classified as an organic acid. TBA has been seen to have biological properties, such as being able to protect against radiation damage in the heart, and it also has been shown to be effective at lowering blood pressure in rats. TBA's chemical formula can be written as C6H5COOH.

Formula: C₁₁H₈O₂S

Purity: Min. 95%

Molecular weight: 204.25 g/mol

Ref: 3D-GAA07249