CAS 60722-67-0

2-(benzyloxy)pyrimidin-4-amine

Description:

2-(Benzyloxy)pyrimidin-4-amine, with the CAS number 60722-67-0, is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a benzyloxy group, which is an ether functional group where a benzyl group is attached to an oxygen atom, enhancing its solubility and reactivity. The presence of an amino group at the 4-position of the pyrimidine ring contributes to its potential as a building block in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit various biological activities, making it of interest in drug discovery. Its structural features suggest that it could participate in hydrogen bonding and other interactions, influencing its reactivity and binding affinity in biological systems. Additionally, the compound's stability, solubility, and reactivity can be influenced by the surrounding functional groups, making it a versatile candidate for further chemical modifications and applications in various fields, including biochemistry and organic synthesis.

Formula: C₁₁H₁₁N₃O

InChI: InChI=1/C11H11N3O/c12-10-6-7-13-11(14-10)15-8-9-4-2-1-3-5-9/h1-7H,8H2,(H2,12,13,14)

SMILES: c1ccc(cc1)COc1nccc(=N)[nH]1

Synonyms:

• 4-Pyrimidinamine, 2-(Phenylmethoxy)-
• 2-(Benzyloxy)pyrimidin-4-amine

2-(Phenylmethoxy)-4-pyrimidinamine

CAS: 60722-67-0

Formula: C₁₁H₁₁N₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 201.2245

Ref: IN-DA00EKSL

2-(Phenylmethoxy)-4-pyrimidinamine

CAS: 60722-67-0

2-(Phenylmethoxy)-4-pyrimidinamine

Purity: 95%

Molecular weight: 201.23g/mol

Ref: 54-OR1075133

2-(phenylmethoxy)-4-pyrimidinamine

CAS: 60722-67-0

Formula: C₁₁H₁₁N₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 201.229

Ref: 10-F076083