CAS 60723-67-3

(2-phenyl-1,3-benzoxazol-4-yl)acetic acid

Description:

(2-phenyl-1,3-benzoxazol-4-yl)acetic acid, with the CAS number 60723-67-3, is an organic compound characterized by its unique structure that includes a benzoxazole ring fused with a phenyl group and an acetic acid moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic compounds. It may display fluorescence due to the presence of the benzoxazole moiety, making it of interest in various applications, including as a fluorescent probe or in organic light-emitting diodes (OLEDs). The presence of the carboxylic acid functional group suggests potential acidity and reactivity, allowing for further derivatization or interaction with biological systems. Additionally, compounds of this type may exhibit biological activity, making them relevant in medicinal chemistry. Overall, (2-phenyl-1,3-benzoxazol-4-yl)acetic acid is a compound of interest in both synthetic and applied chemistry contexts.

Formula: C₁₅H₁₁NO₃

InChI: InChI=1/C15H11NO3/c17-13(18)9-11-7-4-8-12-14(11)16-15(19-12)10-5-2-1-3-6-10/h1-8H,9H2,(H,17,18)

2-(2-Phenyl-1,3-benzoxazol-4-yl)acetic acid

CAS: 60723-67-3

Versatile small molecule scaffold

Formula: C₁₅H₁₁NO₃

Purity: Min. 95%

Molecular weight: 253.25 g/mol

Ref: 3D-KCA72367