CAS 60731-47-7

8-Azido-5′-adenylic acid

Description:

8-Azido-5′-adenylic acid, also known as 8-azido-AMP, is a nucleotide analog characterized by the presence of an azido group (-N3) at the 8-position of the adenine base. This compound is a derivative of adenosine monophosphate (AMP) and is notable for its potential applications in biochemical research, particularly in studies involving nucleic acid interactions and enzyme mechanisms. The azido group can participate in click chemistry reactions, making it useful for labeling and tracking biomolecules. In terms of solubility, 8-azido-5′-adenylic acid is typically soluble in water and polar organic solvents, which facilitates its use in various biochemical assays. Its stability is generally good under physiological conditions, although it may be sensitive to light and certain reactive species. The compound's unique structural features allow it to serve as a valuable tool in molecular biology and biochemistry, particularly in the development of probes and therapeutic agents.

Formula: C₁₀H₁₃N₈O₇P

InChI: InChI=1S/C10H13N8O7P/c11-7-4-8(14-2-13-7)18(10(15-4)16-17-12)9-6(20)5(19)3(25-9)1-24-26(21,22)23/h2-3,5-6,9,19-20H,1H2,(H2,11,13,14)(H2,21,22,23)/t3-,5-,6-,9-/m1/s1

InChI key: InChIKey=DHPCYOPKNHVUPP-UUOKFMHZSA-N

SMILES: N(=[N+]=[N-])C=1N(C=2C(N1)=C(N)N=CN2)[C@@H]3O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]3O

Synonyms:

• 8-Azidoadenosine 5′-phosphate
• 8-Azido-5′-adenylic acid
• 8-Azidoadenosine 5′-monophosphate
• 8-Azido-AMP
• 5′-Adenylic acid, 8-azido-

8-Azidoadenosine 5'-monophosphate sodium salt

CAS: 60731-47-7

8-Azidoadenosine 5'-monophosphate sodium salt is an azido-conjugated adenosine monophosphate derivative used to introduce a label on oligonucleotides. A click reaction between the azide-functionalised nucleotide and a terminal alkyne-functionalised labelled moiety (with either a fluorophore or biotin) generates a stable conjugate containing a triazole link.

Formula: C₁₀H₁₃N₈O₇P

Purity: Min. 95%

Molecular weight: 388.23 g/mol

Ref: 3D-NA71640