CAS 60732-70-9: platinum(2+) cyclohexane-1,2-diyldiazanide - nitric acid (1:1:2)

Description:Platinum(2+) cyclohexane-1,2-diyldiazanide - nitric acid (1:1:2), with the CAS number 60732-70-9, is a coordination compound featuring platinum in a +2 oxidation state. This compound is characterized by its coordination with cyclohexane-1,2-diyldiazanide ligands, which are bidentate, meaning they can form two bonds with the platinum center. The presence of nitric acid in a 1:2 ratio indicates that the compound may exhibit acidic properties, potentially influencing its solubility and reactivity. Platinum complexes are known for their catalytic properties and potential applications in various fields, including catalysis and medicinal chemistry. The structural arrangement of the ligands around the platinum ion can significantly affect the compound's stability, reactivity, and overall chemical behavior. Additionally, the presence of nitrogen-containing ligands may impart unique electronic properties, making such compounds of interest in the study of coordination chemistry and materials science. As with many platinum complexes, safety precautions should be observed due to the potential toxicity of platinum compounds.

Formula:C₆H₁₄N₄O₆Pt

InChI:InChI=1/C6H12N2.2HNO3.Pt/c7-5-3-1-2-4-6(5)8;2*2-1(3)4;/h5-8H,1-4H2;2*(H,2,3,4);/q-2;;;+2