CAS 60758-41-0
:1,3-thiazole-2-carbothioamide
Description:
1,3-Thiazole-2-carbothioamide is a heterocyclic compound characterized by a five-membered ring containing both sulfur and nitrogen atoms. The thiazole ring structure contributes to its unique chemical properties, including its potential as a building block in pharmaceuticals and agrochemicals. This compound features a carbothioamide functional group, which consists of a carbonyl group bonded to a thiol, enhancing its reactivity and potential for forming various derivatives. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. The presence of the thiazole ring often imparts biological activity, making compounds like 1,3-thiazole-2-carbothioamide of interest in medicinal chemistry for their potential antimicrobial, antifungal, or anticancer properties. Additionally, its reactivity can be influenced by the substituents on the thiazole ring, allowing for a range of synthetic modifications. Overall, 1,3-thiazole-2-carbothioamide is a versatile compound with significant implications in chemical research and development.
Formula:C4H4N2S2
InChI:InChI=1/C4H4N2S2/c5-3(7)4-6-1-2-8-4/h1-2H,(H2,5,7)
SMILES:c1csc(C(=S)N)n1
Synonyms:- 2-Thiazolecarbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
