CAS 60758-79-4
:3-ethoxy-4-hydroxybenzonitrile
Description:
3-Ethoxy-4-hydroxybenzonitrile, with the CAS number 60758-79-4, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both an ethoxy group and a hydroxyl group, as well as a nitrile functional group. The presence of the ethoxy group contributes to its solubility in organic solvents, while the hydroxyl group can engage in hydrogen bonding, influencing its reactivity and interaction with other molecules. The nitrile group, characterized by the presence of a carbon triple-bonded to nitrogen, imparts unique chemical properties, including potential reactivity in nucleophilic addition reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its physical properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. Overall, 3-ethoxy-4-hydroxybenzonitrile is a versatile compound with applications in various fields, including medicinal chemistry and materials science.
Formula:C9H9NO2
InChI:InChI=1/C9H9NO2/c1-2-12-9-5-7(6-10)3-4-8(9)11/h3-5,11H,2H2,1H3
SMILES:CCOc1cc(ccc1O)C#N
Synonyms:- Benzonitrile, 3-Ethoxy-4-Hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Ethoxy-4-hydroxybenzonitrile
CAS:Formula:C9H9NO2Purity:95%Color and Shape:SolidMolecular weight:163.17333-Ethoxy-4-hydroxybenzonitrile
CAS:3-Ethoxy-4-hydroxybenzonitrilePurity:98%Molecular weight:163.17g/mol3-ethoxy-4-hydroxybenzonitrile
CAS:3-ethoxy-4-hydroxybenzonitrile is a chemical compound that is found in many plants, such as eucalyptus and lavender. It has been shown to have an attractant effect on Diptera, especially Drosophila dorsalis. The structure of 3-ethoxy-4-hydroxybenzonitrile is similar to that of veratrole and methyl eugenol, both compounds that are known to be chemically attractive to flies. In the laboratory, 3-ethoxy-4-hydroxybenzonitrile has been shown to be more effective than either veratrole or methyl eugenol at attracting Drosophila dorsalis. This chemical can also cause damage when irradiated with ultraviolet light.Formula:C9H9NO2Purity:Min. 95%Molecular weight:163.18 g/mol




