CAS 60758-84-1
:4-propoxybenzonitrile
Description:
4-Propoxybenzonitrile, with the CAS number 60758-84-1, is an organic compound characterized by a benzene ring substituted with a propoxy group and a nitrile group at the para position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its aromatic properties and is often utilized in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the nitrile group contributes to its reactivity, allowing for further chemical transformations. Additionally, 4-propoxybenzonitrile may exhibit moderate solubility in organic solvents, while its solubility in water is generally low due to the hydrophobic nature of the aromatic and propoxy components. Safety data should be consulted for handling, as it may pose health risks if inhaled or ingested. Overall, 4-propoxybenzonitrile is a valuable compound in synthetic organic chemistry with diverse applications.
Formula:C10H11NO
InChI:InChI=1/C10H11NO/c1-2-7-12-10-5-3-9(8-11)4-6-10/h3-6H,2,7H2,1H3
SMILES:CCCOc1ccc(cc1)C#N
Synonyms:- Benzonitrile, 4-Propoxy-
- 4-PROPOXYBENZONITRILE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Propoxybenzonitrile
CAS:4-PropoxybenzonitrileFormula:C10H11NOPurity:≥95%Color and Shape: low-melting solidMolecular weight:161.20g/mol4-Propyloxybenzonitrile
CAS:<p>The chemical compound 4-propyloxybenzonitrile (4-POBA) is a high quality, useful intermediate and speciality chemical. It is a reagent with a CAS No. of 60758-84-1 that can be used in the synthesis of complex compounds or as a building block for the preparation of speciality chemicals. 4-POBA has been shown to have multiple uses in organic synthesis, including as a building block for the synthesis of heterocyclic compounds and as an intermediate in the preparation of fine chemicals such as pharmaceuticals and pesticides. The versatility of this compound makes it an excellent scaffold for research chemicals.</p>Formula:C10H11NOPurity:Min. 95%Color and Shape:PowderMolecular weight:161.2 g/mol
