CAS 60758-95-4

4-propoxybenzenecarbothioamide

Description:

4-Propoxybenzenecarbothioamide, identified by its CAS number 60758-95-4, is an organic compound characterized by the presence of a propoxy group and a carbothioamide functional group attached to a benzene ring. This compound typically exhibits properties associated with both aromatic and thioamide functionalities, which may influence its solubility, reactivity, and potential applications. The propoxy group contributes to its hydrophobic characteristics, while the carbothioamide group can engage in hydrogen bonding and may exhibit biological activity. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, compounds of this nature are often studied for their potential use in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases for precise applications and handling guidelines.

Formula: C₁₀H₁₃NOS

InChI: InChI=1/C10H13NOS/c1-2-7-12-9-5-3-8(4-6-9)10(11)13/h3-6H,2,7H2,1H3,(H2,11,13)

SMILES: CCCOc1ccc(cc1)C(=S)N

Synonyms:

• Benzenecarbothioamide, 4-Propoxy-
• 4-Propoxybenzenecarbothioamide

4-Propoxybenzene-1-carbothioamide

CAS: 60758-95-4

Versatile small molecule scaffold

Formula: C₁₀H₁₃NOS

Purity: Min. 95%

Molecular weight: 195.28 g/mol

Ref: 3D-KCA75895