CAS 60772-67-0
:3-Isopropoxybenzoic acid
Description:
3-Isopropoxybenzoic acid, with the CAS number 60772-67-0, is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with an isopropoxy group at the meta position. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while its solubility in water is limited due to the hydrophobic nature of the isopropoxy group. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its structure suggests potential applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Additionally, the isopropoxy group may influence the compound's reactivity and interaction with biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C10H12O3
InChI:InChI=1/C10H12O3/c1-7(2)13-9-5-3-4-8(6-9)10(11)12/h3-7H,1-2H3,(H,11,12)
SMILES:CC(C)Oc1cccc(c1)C(=O)O
Synonyms:- Benzoic acid, 3-(1-methylethoxy)-
- Qvr Coy1& 1 [Wln]
- 3-(Propan-2-Yloxy)Benzoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Isopropoxybenzoic acid
CAS:Formula:C10H12O3Purity:97%Color and Shape:SolidMolecular weight:180.20053-iso-Propoxybenzoic acid
CAS:Formula:C10H12O3Purity:95%Color and Shape:SolidMolecular weight:180.2033-Isopropoxybenzoic Acid
CAS:Controlled ProductApplications 3-Isopropoxybenzoic acid is a useful reagent for organic synthesis and other chemical processes.
References Chiong, H. A., et al.: J. Am. Chem. Soc., 129, 9879 (2007); Kingston, D. G. I., et al.: J. Med. Chem., 41, 3715 (1998)Formula:C10H12O3Color and Shape:White To Off-WhiteMolecular weight:180.2



