CAS 60772-72-7
:2-Chloro-5-(1,1-dimethylethyl)benzoic acid
Description:
2-Chloro-5-(1,1-dimethylethyl)benzoic acid, with the CAS number 60772-72-7, is an aromatic carboxylic acid characterized by the presence of a chlorine atom and a tert-butyl group on the benzene ring. This compound features a chloro substituent at the 2-position and a bulky tert-butyl group at the 5-position of the benzoic acid structure, which influences its physical and chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents while being less soluble in water due to its hydrophobic tert-butyl group. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the chlorine atom can enhance the compound's reactivity and influence its biological activity. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in synthesis and as an intermediate in chemical processes.
Formula:C11H13ClO2
InChI:InChI=1S/C11H13ClO2/c1-11(2,3)7-4-5-9(12)8(6-7)10(13)14/h4-6H,1-3H3,(H,13,14)
InChI key:InChIKey=AQGAOYCHKNUAJK-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(C(C)(C)C)=CC=C1Cl
Synonyms:- 2-Chloro-5-(1,1-dimethylethyl)benzoic acid
- Benzoic acid, 2-chloro-5-(1,1-dimethylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
