CAS 607737-87-1

4-[5-(6-methylpyridin-2-yl)-1H-pyrazol-4-yl]quinoline

Description:

4-[5-(6-methylpyridin-2-yl)-1H-pyrazol-4-yl]quinoline, with the CAS number 607737-87-1, is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a pyrazole ring substituted with a pyridine group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and drug development. The presence of multiple heteroatoms and aromatic systems in its structure may contribute to its ability to interact with biological targets, potentially influencing its pharmacological properties. Additionally, the methyl group on the pyridine ring can affect the compound's electronic properties and steric hindrance, which may play a role in its reactivity and binding affinity. Overall, this compound represents a class of heterocyclic compounds that are often explored for their therapeutic potential in various diseases, including cancer and inflammation. Further studies would be necessary to elucidate its specific biological activities and mechanisms of action.

Formula: C₁₈H₁₄N₄

InChI: InChI=1/C18H14N4/c1-12-5-4-8-17(21-12)18-15(11-20-22-18)13-9-10-19-16-7-3-2-6-14(13)16/h2-11H,1H3,(H,20,22)

SMILES: Cc1cccc(c2c(c[nH]n2)c2ccnc3ccccc23)n1

Synonyms:

• 4-[3-(6-Methylpyridin-2-yl)-1H-pyrazol-4-yl]quinoline
• quinoline, 4-[3-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-
• quinoline, 4-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-

4-[3-(6-METHYL-2-PYRIDINYL)-1H-PYRAZOL-4-YL]-QUINOLINE

CAS: 607737-87-1

Formula: C₁₈H₁₄N₄

Purity: %

Color and Shape: Solid

Molecular weight: 286.3306

Ref: IN-DA00EBM5

A 77-01

CAS: 607737-87-1

A 77-01

Purity: ≥95%

Molecular weight: 286.33g/mol

Ref: 54-BUP02345

A 77-01

CAS: 607737-87-1

A 77-01 is a potent inhibitor of TGF-(beta) type I receptor superfamily activin-like kinase ALK5 with IC50 of 25 nM.

Formula: C₁₈H₁₄N₄

Purity: 98.82% - ≥95%

Color and Shape: Solid

Molecular weight: 286.33

Ref: TM-T2098