CAS 6078-17-7
:16H-1,24:6,9-Dietheno-11,15-metheno-2H-pyrido[2′,3′:17,18][1,11]dioxacycloeicosino[2,3,4-ij]isoquinolin-12-ol, 3,4,4a,5,16a,17,18,19-octahydro-21,22,26-trimethoxy-4,17-dimethyl-, hydrochloride (1:2), (4aS,16aR)-
Description:
The chemical substance known as 16H-1,24:6,9-Dietheno-11,15-metheno-2H-pyrido[2′,3′:17,18][1,11]dioxacycloeicosino[2,3,4-ij]isoquinolin-12-ol, 3,4,4a,5,16a,17,18,19-octahydro-21,22,26-trimethoxy-4,17-dimethyl-, hydrochloride (1:2), (4aS,16aR)-, with the CAS number 6078-17-7, is a complex organic compound characterized by its intricate polycyclic structure and multiple functional groups. This substance features a combination of methoxy groups, a hydroxyl group, and a unique bicyclic framework that contributes to its potential biological activity. The presence of stereocenters indicates chirality, which may influence its pharmacological properties. As a hydrochloride salt, it is likely to exhibit enhanced solubility in aqueous environments, making it suitable for various applications in medicinal chemistry. The compound's structural complexity suggests potential interactions with biological targets, warranting further investigation into its therapeutic efficacy and safety profile. Overall, this substance exemplifies the rich diversity found in organic chemistry, particularly in the realm of alkaloids and related compounds.
Formula:C37H40N2O6·2ClH
InChI:InChI=1S/C37H40N2O6.2ClH/c1-38-14-12-24-19-32(41-3)33-21-27(24)28(38)16-22-6-9-26(10-7-22)44-31-18-23(8-11-30(31)40)17-29-35-25(13-15-39(29)2)20-34(42-4)36(43-5)37(35)45-33;;/h6-11,18-21,28-29,40H,12-17H2,1-5H3;2*1H/t28-,29+;;/m0../s1
InChI key:InChIKey=USRXDYNDPPUBSG-KKXMJGKMSA-N
SMILES:O(C)C1=C2C3=C(C=C1OC)CCN(C)[C@@]3(CC=4C=C(OC=5C=CC(C[C@]6(C7=CC(O2)=C(OC)C=C7CCN6C)[H])=CC5)C(O)=CC4)[H].Cl
Synonyms:- Berbaman-12-ol, 6,6′,7-trimethoxy-2,2′-dimethyl-, dihydrochloride
- 16H-1,24:6,9-Dietheno-11,15-metheno-2H-pyrido[2′,3′:17,18][1,11]dioxacycloeicosino[2,3,4-ij]isoquinolin-12-ol, 3,4,4a,5,16a,17,18,19-octahydro-21,22,26-trimethoxy-4,17-dimethyl-, hydrochloride (1:2), (4aS,16aR)-
- 16H-1,24:6,9-Dietheno-11,15-metheno-2H-pyrido[2′,3′:17,18][1,11]dioxacycloeicosino[2,3,4-ij]isoquinoline, berbaman-12-ol deriv.
- Berbamine, dihydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Berbamine (hydrochloride)
CAS:Formula:C37H42Cl2N2O6Purity:98%Color and Shape:SolidMolecular weight:681.6452Berbamine dihydrochloride
CAS:Formula:C37H40N2O6·2HClPurity:≥ 95.0%Color and Shape:White to off-white powderMolecular weight:681.65Berbamine dihydrochloride
CAS:Berbamine dihydrochloride (Berbamine), a natural compound derived from the Berberis amurensis plant, has been shown to exhibit antitumor activity in several Ys.Formula:C37H42Cl2N2O6Purity:95% - 99.99%Color and Shape:SolidMolecular weight:681.65Berbamine dihydrochloride
CAS:Berbamine dihydrochloride is a chemical compound, specifically an alkaloid derivative. It is sourced from natural plant origins, primarily extracted from species within the Berberidaceae family, such as Berberis amurensis. The compound functions by interacting with cellular signaling pathways, exerting effects on calcium ions within cells, which influences various biological processes such as apoptosis and cell proliferation.
Formula:C37H40N2O6·2HClColor and Shape:PowderMolecular weight:681.64 g/mol







