CAS 60781-86-4
:4-Pentyl-2-pyridinamine
Description:
4-Pentyl-2-pyridinamine, with the CAS number 60781-86-4, is an organic compound characterized by its pyridine ring substituted with a pentyl group and an amino group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, reflecting its hydrophobic pentyl chain. The presence of the amino group contributes to its basicity and potential reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The compound's properties, including melting point, boiling point, and specific reactivity, can vary based on environmental conditions and purity. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, 4-Pentyl-2-pyridinamine is a versatile compound with interesting chemical properties that warrant further investigation for various applications.
Formula:C10H16N2
InChI:InChI=1S/C10H16N2/c1-2-3-4-5-9-6-7-12-10(11)8-9/h6-8H,2-5H2,1H3,(H2,11,12)
InChI key:InChIKey=OBUPQUOZQOFTMF-UHFFFAOYSA-N
SMILES:C(CCCC)C=1C=C(N)N=CC1
Synonyms:- 2-Amino-4-n-amylpyridine
- 2-Amino-4-pentylpyridine
- Pyridine, 2-amino-4-pentyl-
- 2-Pyridinamine, 4-pentyl-
- 4-Pentyl-2-pyridinamine
- 4-PENTYL-PYRIDIN-2-YLAMINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Pentyl-pyridin-2-ylamine
CAS:Formula:C10H16N2Color and Shape:Solid, Low Melting SolidMolecular weight:164.252
