CAS 60783-93-9
:5-Bromo-2-(2-methylpropoxy)benzoic acid
Description:
5-Bromo-2-(2-methylpropoxy)benzoic acid is an organic compound characterized by its aromatic structure, which includes a bromine substituent and a propoxy group attached to a benzoic acid moiety. The presence of the bromine atom introduces notable electrophilic properties, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions. The propoxy group enhances the compound's solubility in organic solvents, while the carboxylic acid functional group contributes to its acidity and potential for forming hydrogen bonds. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various functionalization possibilities, which can be explored in synthetic chemistry. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents on the aromatic ring. Overall, 5-Bromo-2-(2-methylpropoxy)benzoic acid serves as a versatile building block in organic synthesis and medicinal chemistry.
Formula:C11H13BrO3
InChI:InChI=1S/C11H13BrO3/c1-7(2)6-15-10-4-3-8(12)5-9(10)11(13)14/h3-5,7H,6H2,1-2H3,(H,13,14)
InChI key:InChIKey=IRNNDNQWGQNULE-UHFFFAOYSA-N
SMILES:O(CC(C)C)C1=C(C(O)=O)C=C(Br)C=C1
Synonyms:- Benzoic acid, 5-bromo-2-(2-methylpropoxy)-
- 5-Bromo-2-isobutoxybenzoic acid
- 5-Bromo-2-(2-methylpropoxy)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.