CAS 60786-59-6
:(thr4,gly7)-oxytocin
Description:
The chemical substance known as (Thr4,Gly7)-oxytocin, with the CAS number 60786-59-6, is a synthetic analog of the naturally occurring hormone oxytocin. This peptide consists of a chain of nine amino acids, with specific modifications at the fourth and seventh positions, where threonine (Thr) and glycine (Gly) replace the original residues found in oxytocin. These modifications can influence the peptide's biological activity, receptor binding affinity, and stability. (Thr4,Gly7)-oxytocin is primarily studied for its potential therapeutic applications, particularly in areas related to social behavior, emotional regulation, and reproductive health. It may exhibit altered pharmacokinetics compared to natural oxytocin, which can enhance its efficacy in certain clinical settings. As a peptide, it is typically administered via injection due to its susceptibility to degradation in the gastrointestinal tract. Overall, (Thr4,Gly7)-oxytocin represents a valuable tool in both research and potential therapeutic interventions, particularly in understanding the roles of oxytocin in various physiological processes.
Formula:C39H61N11O12S2
InChI:InChI=1/C39H61N11O12S2/c1-6-19(4)31(49-37(60)25(46-33(56)23(40)16-63)12-21-7-9-22(52)10-8-21)38(61)50-32(20(5)51)39(62)47-26(13-28(41)53)36(59)48-27(17-64)35(58)44-15-30(55)45-24(11-18(2)3)34(57)43-14-29(42)54/h7-10,16,18-20,23-27,31-32,51-52,64H,6,11-15,17,40H2,1-5H3,(H2,41,53)(H2,42,54)(H,43,57)(H,44,58)(H,45,55)(H,46,56)(H,47,62)(H,48,59)(H,49,60)(H,50,61)/t19-,20+,23-,24-,25-,26-,27-,31-,32-/m0/s1
Synonyms:- H-Cys-Tyr-Ile-Thr-Asn-Cys-Gly-Leu-Gly-NH2 (Disulfide bond)
- 3-thioxo-L-alanyl-L-tyrosyl-L-isoleucyl-L-threonyl-L-asparaginyl-L-cysteinylglycyl-L-leucylglycinamide
- Cys-Tyr-Ile-Thr-Asn-Cys-Gly-Leu-Gly-Nh2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(Thr⁴,Gly⁷)-Oxytocin
CAS:TGOT exhibits a 640-fold increase in oxytocic/ antidiuretic selectivity relative to oxytocin.Formula:C39H61N11O12S2Purity:99.6%Color and Shape:White LyophilisateMolecular weight:940.11(Thr4,Gly7)-Oxytocin
CAS:<p>Oxytocin is a hormone that is released from the pituitary gland. It has been shown to have a variety of biological effects, including stimulation of uterine contractions, breast milk production, and social behaviors such as bonding and sexual behavior. Oxytocin has also been shown to regulate the release of gamma-aminobutyric acid (GABA) in the brain. This effect may be due to oxytocin's ability to stimulate GABA receptors. In addition, oxytocin can inhibit lipolysis by inhibiting the release of fatty acids from adipose tissue. The effect on fatty acid release is due to an inhibition of phosphodiesterase activity. Oxytocin can also cause membrane hyperpolarization by increasing potassium ion flow through channels in the cell membrane. Oxytocin has also been shown to act as a growth factor for certain types of cells, such as smooth muscle cells and osteoblasts.</p>Formula:C39H61N11O12S2Purity:Min. 95%Molecular weight:940.1 g/mol

