CAS 60796-65-8

5,7,8-Trimethoxycoumarin

Description:

5,7,8-Trimethoxycoumarin is a synthetic organic compound belonging to the coumarin family, characterized by its three methoxy groups attached to the coumarin backbone. This compound typically exhibits a pale yellow to white crystalline appearance and is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. 5,7,8-Trimethoxycoumarin is often studied in the context of medicinal chemistry and natural product research, where it may serve as a lead compound for the development of new therapeutic agents. Its molecular structure allows for various substitutions, which can be explored to optimize its pharmacological effects. Additionally, this compound may be utilized in the field of photochemistry due to its ability to absorb ultraviolet light, making it of interest in both academic and industrial applications. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₂H₁₂O₅

InChI: InChI=1S/C12H12O5/c1-14-8-6-9(15-2)12(16-3)11-7(8)4-5-10(13)17-11/h4-6H,1-3H3

InChI key: InChIKey=MSFXSDYNQKVMTJ-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(=C(OC)C=C1OC)C=CC(=O)O2

Synonyms:

• 5,7,8-Trimethoxycoumarin
• 5,7,8-Trimethoxy-2H-1-benzopyran-2-one
• 2H-1-Benzopyran-2-one, 5,7,8-trimethoxy-

5,7,8-Trimethoxycoumarin

CAS: 60796-65-8

Formula: C₁₂H₁₂O₅

Purity: 98%

Molecular weight: 236.2207

Ref: IN-DA00EGSZ

5,7,8-Trimethoxycoumarin

CAS: 60796-65-8

5,7,8-Trimethoxycoumarin is a natural product of Viola, Violaceae.

Formula: C₁₂H₁₂O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 236.22

Ref: TM-TN5871

5,7,8-Trimethoxycoumarin

CAS: 60796-65-8

Formula: C₁₂H₁₂O₅

Purity: 95%~99%

Molecular weight: 236.223

Ref: BP-SBP00108

5,7,8-Trimethoxycoumarin

CAS: 60796-65-8

5,7,8-Trimethoxycoumarin is a naturally-derived coumarin compound, which is primarily sourced from various plant species known for producing coumarins as secondary metabolites. This compound is characterized by its three methoxy groups attached to the coumarin skeleton, providing it with unique chemical properties that can influence its biological activity.

Formula: C₁₂H₁₂O₅

Purity: Min. 95%

Molecular weight: 236.22 g/mol

Ref: 3D-KCA79665