CAS 608-16-2

biotin methyl ester

Description:

Biotin methyl ester, with the CAS number 608-16-2, is a derivative of biotin, a water-soluble B-vitamin (B7) that plays a crucial role in various metabolic processes, including fatty acid synthesis and amino acid metabolism. This compound typically appears as a white to off-white crystalline powder and is known for its stability under standard conditions. Biotin methyl ester is soluble in organic solvents such as methanol and ethanol, but it has limited solubility in water due to its hydrophobic methyl ester group. The compound is often used in biochemical research and applications, particularly in studies related to enzyme activity and protein interactions, owing to its ability to mimic the natural biotin structure. Its functional groups allow for various chemical modifications, making it a versatile tool in synthetic organic chemistry. Additionally, biotin methyl ester can be utilized in the development of biotinylated probes for labeling and detection in biological assays. Overall, its unique properties make it an important compound in both research and potential therapeutic applications.

Formula: C₁₁H₁₈N₂O₃S

InChI: InChI=1/C11H18N2O3S/c1-16-9(14)5-3-2-4-8-10-7(6-17-8)12-11(15)13-10/h7-8,10H,2-6H2,1H3,(H2,12,13,15)/t7-,8-,10-/m0/s1

SMILES: COC(=O)CCCC[C@H]1[C@@H]2[C@H](CS1)N=C(N2)O

Biotin methyl ester

CAS: 608-16-2

Formula: C₁₁H₁₈N₂O₃S

Purity: 95%

Color and Shape: Solid

Molecular weight: 258.3372

Ref: IN-DA00ELI7

Biotin methyl ester

CAS: 608-16-2

Biotin methyl ester

Purity: 96%

Ref: 54-OR1042191

Biotin methyl ester

CAS: 608-16-2

Formula: C₁₁H₁₈N₂O₃S

Purity: ≥ 96%

Color and Shape: White to off-white powder or solid

Molecular weight: 258.34

Ref: 7W-GL8219

Biotinmethylester

CAS: 608-16-2

Purity: 97.0%

Molecular weight: 258.3399963378906

Ref: 10-F547418

(+)-Biotin Methyl Ester

Controlled Product

CAS: 608-16-2

Applications (+)-Biotin Methyl Ester is an protected intermediate in the synthesis of Biotin (B389040).
References Lauw, S.J. L., et al.: Electrochimica, A., et al.: 114, 514 (2013); Pehere, A.D.,, et al.: J. Org. Chem., 76, 9514 (2011);

Formula: C₁₁H₁₈N₂O₃S

Color and Shape: Neat

Molecular weight: 258.34

Ref: TR-B390480

(+)-Biotin methyl ester

CAS: 608-16-2

(+)-Biotin methyl ester is an amphipathic molecule that binds to specific receptors on the surface of mammalian cells. This binding leads to cell activation and an increase in gene expression. (+)-Biotin methyl ester also has the ability to be used as a diagnostic agent for cervical cancer, as it can bind to the surface of tumor cells, which triggers a change in optical properties. The molecule can also be used for immobilization purposes or as a skeleton molecule in microcapsules.

Formula: C₁₁H₁₈N₂O₃S

Purity: Min. 95%

Molecular weight: 258.34 g/mol

Ref: 3D-AAA60816