CAS 608-36-6: rel-(2R,3S)-2,3-Dibromobutanedioic acid
Description:Rel-(2R,3S)-2,3-Dibromobutanedioic acid, with the CAS number 608-36-6, is a dibromo derivative of butanedioic acid, characterized by the presence of two bromine atoms attached to the second and third carbon atoms of the butanedioic acid backbone. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols due to the presence of carboxylic acid functional groups. The stereochemistry indicated by the (2R,3S) configuration suggests specific spatial arrangements of the bromine substituents, which can influence the compound's reactivity and interactions with biological systems. As a dibromo compound, it may exhibit unique properties such as increased reactivity in nucleophilic substitution reactions. Additionally, its potential applications could span various fields, including organic synthesis and medicinal chemistry, where brominated compounds are often explored for their biological activity. Safety precautions should be taken when handling this compound, as brominated substances can pose health risks.
Formula:C4H4Br2O4
InChI:InChI=1/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10)/t1-,2+
InChI key:InChIKey=FJWGRXKOBIVTFA-XIXRPRMCNA-N
SMILES:O=C(O)C(Br)C(Br)C(=O)O
- Synonyms:
- (2R,3S)-2,3-dibromobutanedioate
- (2R,3S)-2,3-dibromobutanedioic acid
- 2,3-Dibromo Dibutyric Acid
- 2,3-Dibromosucinic Acid
- Butanedioic acid, 2,3-dibromo-, (2R,3S)-rel-
- Butanedioic acid, 2,3-dibromo-, (R*,S*)-
- Dibromosuccinicacid
- NSC 100886
- Succinic acid, 2,3-dibromo-, meso-
- meso-2,3-Dibromosuccinic acid
- See more synonyms
- meso-Dibromosuccinic acid
- rel-(2R,3S)-2,3-Dibromobutanedioic acid
