CAS 608-38-8: (2E)-2,3-Dibromo-2-butenedioic acid

Description:(2E)-2,3-Dibromo-2-butenedioic acid, with the CAS number 608-38-8, is an organic compound characterized by its structure, which includes two bromine atoms and a conjugated diene system. This compound features a double bond between the second and third carbon atoms, contributing to its reactivity and potential applications in organic synthesis. It is a dibromo derivative of maleic acid, which means it possesses both carboxylic acid functional groups and bromine substituents. The presence of these functional groups imparts acidity and enhances the compound's ability to participate in various chemical reactions, such as nucleophilic substitutions and addition reactions. The compound is typically a colorless to pale yellow solid and is soluble in polar solvents. Its reactivity and structural features make it of interest in the fields of synthetic organic chemistry and materials science. Safety precautions should be taken when handling this compound due to the presence of bromine, which can be hazardous.

Formula:C₄H₂Br₂O₄

InChI:InChI=1S/C4H2Br2O4/c5-1(3(7)8)2(6)4(9)10/h(H,7,8)(H,9,10)/b2-1+

InChI key:InChIKey=PMNMPRXRQYSFRP-OWOJBTEDSA-N

SMILES:O=C(O)C(Br)=C(Br)C(=O)O