
CAS 608-74-2
:1,2,3,4,5,6-Hexaiodobenzene
Description:
1,2,3,4,5,6-Hexaiodobenzene is an aromatic compound characterized by the presence of six iodine atoms attached to a benzene ring. This compound is notable for its high degree of halogenation, which significantly influences its chemical properties and reactivity. The presence of multiple iodine atoms enhances its electron-withdrawing characteristics, making it less reactive in electrophilic substitution reactions compared to less halogenated benzene derivatives. Hexaiodobenzene is typically a solid at room temperature and may exhibit a crystalline structure. Its solubility is generally low in non-polar solvents due to the bulky iodine substituents, but it may dissolve in polar solvents to some extent. The compound is of interest in various fields, including materials science and organic synthesis, where it can serve as a precursor for the development of iodinated compounds or as a reagent in chemical reactions. Additionally, due to its unique structure, it may have applications in the field of medicinal chemistry and as a potential agent in imaging techniques. Safety precautions should be taken when handling this compound, as iodine is toxic and can pose health risks.
Formula:C6I6
InChI:InChI=1S/C6I6/c7-1-2(8)4(10)6(12)5(11)3(1)9
InChI key:InChIKey=QNMKKFHJKJJOMZ-UHFFFAOYSA-N
SMILES:IC1=C(I)C(I)=C(I)C(I)=C1I
Synonyms:- Benzene, 1,2,3,4,5,6-hexaiodo-
- Benzene, hexaiodo-
- Hexaiodobenzene
- Periodobenzene
- 1,2,3,4,5,6-Hexaiodobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.