CymitQuimica logo

CAS 60811-24-7

:

3,4-Difluoro thiophenol

Description:
3,4-Difluorothiophenol is an organofluorine compound characterized by the presence of both fluorine atoms and a thiol functional group (-SH) attached to a thiophene ring. This compound features a five-membered aromatic ring containing sulfur, which contributes to its unique chemical properties. The presence of the two fluorine atoms at the 3 and 4 positions of the thiophenol structure enhances its reactivity and influences its electronic properties, making it a valuable intermediate in organic synthesis and materials science. 3,4-Difluorothiophenol is typically a colorless to pale yellow liquid with a distinct odor, and it is soluble in organic solvents. Its reactivity can be attributed to the electron-withdrawing nature of the fluorine atoms, which can affect nucleophilicity and electrophilicity in chemical reactions. Additionally, this compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Proper handling and safety precautions are essential due to its potential toxicity and reactivity.
Formula:C6H3F2S
InChI:InChI=1/C6H4F2S/c7-5-2-1-4(9)3-6(5)8/h1-3,9H/p-1
InChI key:BGVRHDQMTMPAEZ-UHFFFAOYSA-N
SMILES:c1cc(c(cc1[S-])F)F
Synonyms:
  • 3,4-Difluorothiophenol
  • 3,4-Difluorobenzenethiol
  • 3,4-Difluorobenzenethiolate
Found 5 products.