CAS 60816-70-8
:Lithium gluconate
Description:
Lithium gluconate is a chemical compound that serves as a lithium salt of gluconic acid. It is typically encountered as a white to off-white crystalline powder, which is soluble in water. The compound is known for its use in the treatment of bipolar disorder, where it acts as a mood stabilizer by modulating neurotransmitter activity in the brain. Lithium gluconate is characterized by its relatively low toxicity compared to other lithium salts, making it a preferred choice in certain therapeutic applications. In addition to its medicinal uses, it may also be utilized in various industrial applications, including as a dietary supplement. The compound has a molecular formula that reflects its composition of lithium, carbon, hydrogen, and oxygen, and it exhibits hygroscopic properties, meaning it can absorb moisture from the environment. As with all lithium compounds, careful monitoring of dosage is essential due to the potential for lithium toxicity, which can lead to serious health complications if not managed properly.
Formula:C6H12O7·Li
InChI:InChI=1S/C6H12O7.Li/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/t2-,3-,4+,5-;/m1./s1
InChI key:InChIKey=RBPRYZGJVXOHCW-JJKGCWMISA-N
SMILES:[C@H]([C@@H]([C@@H](CO)O)O)([C@H](C(O)=O)O)O.[Li]
Synonyms:- <span class="text-smallcaps">D</span>-Gluconic acid, lithium salt (1:1)
- <span class="text-smallcaps">D</span>-Gluconic acid, monolithium salt
- Lithioderm
- Lithium Gluconate
- lithium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (non-preferred name)
- D-Gluconic acid, lithium salt (1:1)
- D-Gluconic acid, monolithium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
D-Gluconic acid lithium salt
CAS:D-Gluconic acid lithium salt is a cationic compound that has been shown to inhibit the growth of bacteria by forming a covalent linkage with the ribose in RNA. This inhibits the enzyme activity of the cell and prevents transcription and replication. The chemical formula for this compound is CH3CH2OH-CH2COOH+Li+→CH3CH2OLi+H2O, where D-gluconic acid is carboxylate anion and lithium ion is cation. Electrophoresis studies have shown that this compound binds to proteins, which may be due to its hydrophilic properties. X-ray diffraction data has revealed that it forms a crystalline structure. This compound can be used as an antimicrobial agent against Group P2 Gram-positive cocci (e.g., Enterococcus faecalis) and other infectious diseases such as Staphylococcus aureus, Streptococcus pneumoniaFormula:C6H11O7LiPurity:Min. 95%Color and Shape:White PowderMolecular weight:202.09 g/mol
