CAS 6082-86-6

N-(4-{[(naphthalen-2-yloxy)acetyl]amino}phenyl)butanamide

Description:

N-(4-{[(naphthalen-2-yloxy)acetyl]amino}phenyl)butanamide, with the CAS number 6082-86-6, is a synthetic organic compound characterized by its complex structure, which includes a naphthalene moiety, an amide functional group, and a butanamide chain. This compound typically exhibits properties associated with amides, such as moderate solubility in organic solvents and potential bioactivity due to its structural features. The presence of the naphthalen-2-yloxy group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may confer specific pharmacological properties, including anti-inflammatory or analgesic effects, although detailed biological activity would require empirical investigation. Additionally, the compound's stability, reactivity, and interaction with other substances can be influenced by its functional groups, making it a candidate for further research in drug development or chemical synthesis applications. Overall, this compound exemplifies the complexity and diversity of synthetic organic molecules in the field of chemistry.

Formula: C₂₂H₂₂N₂O₃

InChI: InChI=1/C22H22N2O3/c1-2-5-21(25)23-18-9-11-19(12-10-18)24-22(26)15-27-20-13-8-16-6-3-4-7-17(16)14-20/h3-4,6-14H,2,5,15H2,1H3,(H,23,25)(H,24,26)

SMILES: CCCC(=O)Nc1ccc(cc1)NC(=O)COc1ccc2ccccc2c1

Synonyms:

• butanamide, N-[4-[[2-(2-naphthalenyloxy)acetyl]amino]phenyl]-
• N-(4-{[(2-Naphthyloxy)acetyl]amino}phenyl)butanamide

3-[3-(2-Carboxyethyl)phenyl]propanoic acid

CAS: 6082-86-6

3-[3-(2-Carboxyethyl)phenyl]propanoic acid is a reagent used in oxidation reactions. It has been shown to be a good catalyst for the amination of alkanes, as well as oxidation of benzylic substrates. 3-[3-(2-Carboxyethyl)phenyl]propanoic acid is a dinuclear molecule with two sulfamoyl groups. The sulfamoyl group can be oxidized by adding an oxidizing agent such as hydrogen peroxide or potassium permanganate. This then leads to the formation of the sulfonamide and carboxylic acid products.

Formula: C₁₂H₁₄O₄

Purity: Min. 95%

Molecular weight: 222.24 g/mol

Ref: 3D-GAA08286