CAS 60831-31-4
:[(3S,4S,5S,6R)-6-[(2S,3S,4R,5S)-3-acetamido-2-benzyloxy-5-hydroxy-6-(hydroxymethyl)tetrahydropyran-4-yl]oxy-3,4,5-triacetoxy-tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance with the name "[(3S,4S,5S,6R)-6-[(2S,3S,4R,5S)-3-acetamido-2-benzyloxy-5-hydroxy-6-(hydroxymethyl)tetrahydropyran-4-yl]oxy-3,4,5-triacetoxy-tetrahydropyran-2-yl]methyl acetate" and CAS number 60831-31-4 is a complex organic compound characterized by its intricate stereochemistry and multiple functional groups. It features a tetrahydropyran backbone, which is a six-membered cyclic ether, and includes several acetoxy groups, indicating the presence of acetate moieties that can influence its reactivity and solubility. The compound also contains an acetamido group, which suggests potential biological activity, possibly as a pharmaceutical agent. The presence of benzyloxy and hydroxymethyl groups further enhances its structural complexity and may contribute to its interactions in biological systems. Overall, this substance is likely to exhibit specific properties such as solubility in organic solvents, potential for hydrogen bonding, and reactivity due to its functional groups, making it of interest in medicinal chemistry and related fields.
Formula:C29H39NO15
InChI:InChI=1/C29H39NO15/c1-14(32)30-22-25(23(37)20(11-31)43-28(22)39-12-19-9-7-6-8-10-19)45-29-27(42-18(5)36)26(41-17(4)35)24(40-16(3)34)21(44-29)13-38-15(2)33/h6-10,20-29,31,37H,11-13H2,1-5H3,(H,30,32)/t20?,21?,22-,23+,24-,25+,26-,27-,28-,29-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Benzyl 2-acetamido-2-deoxy-3-O-(2,3,4,6-tetra-O-acetyl-b-D-galactopyranosyl)-a-D-glucopyranoside
CAS:<p>Benzyl 2-acetamido-2-deoxy-3-O-(2,3,4,6-tetra-O-acetyl-b-D-galactopyranosyl)-a-D-glucopyranoside is a carbohydrate that belongs to the group of saccharides. It is a member of the class of oligosaccharides and has a CAS number of 60831-31-4. This compound is synthesized from benzyl 2,3,4,6 tetra acetyl b D galactopyranoside in which a sugar molecule has been added to the end of the chain. Benzyl 2 acetamido 2 deoxy 3 O (2,3,4,6 tetra O acetyl b D galactopyranosyl) a D glucopyranoside is also known as 2 alpha -D glucopyranose or α -D glucopyranose. This</p>Formula:C29H39NO15Purity:Min. 95%Molecular weight:641.62 g/mol

