CAS 60835-69-0: 2,3,5,6,8,9,11,12-Octahydro-15-nitro-1,4,7,10,13-benzopentaoxacyclopentadecin
Description:2,3,5,6,8,9,11,12-Octahydro-15-nitro-1,4,7,10,13-benzopentaoxacyclopentadecin, with CAS number 60835-69-0, is a complex organic compound characterized by its unique polycyclic structure that incorporates multiple oxygen atoms within its framework. This compound features a nitro group, which can influence its reactivity and stability. The presence of multiple rings and functional groups suggests potential applications in various fields, including materials science and pharmaceuticals. Its structural complexity may also impart interesting physical properties, such as solubility and melting point, which are critical for its practical applications. Additionally, the nitro group can enhance the compound's energetic properties, making it of interest in the study of explosives or propellants. However, specific safety and handling guidelines should be followed due to the potential hazards associated with nitro compounds. Overall, this substance exemplifies the intricate relationship between molecular structure and chemical behavior, warranting further investigation for its potential uses.
Formula:C14H19NO7
InChI:InChI=1S/C14H19NO7/c16-15(17)12-1-2-13-14(11-12)22-10-8-20-6-4-18-3-5-19-7-9-21-13/h1-2,11H,3-10H2
InChI key:InChIKey=XIWRBQVYCZCEPG-UHFFFAOYSA-N
SMILES:O=N(=O)C1=CC=C2OCCOCCOCCOCCOC2=C1
- Synonyms:
- 1,4,7,10,13-Benzopentaoxacyclopentadecin, 2,3,5,6,8,9,11,12-octahydro-15-nitro-
- 15-Nitro-2,3,5,6,8,9,11,12-Octahydro-1,4,7,10,13-Benzopentaoxacyclopentadecine
- 17-Nitro-2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-triene
- 2,3,5,6,8,9,11,12-Octahydro-15-nitro-1,4,7,10,13-benzopentaoxacyclopentadecin
- 2-Nitro-6,7,9,10,12,13,15,16-octahydro-5,8,11,14,17-pentaoxa-benzocyclopentadecene
- NSC 175879
- 4-Nitrobenzo-15-crown-5
- (4'-Nitrobenzo)-15-crown-5
