CAS 60835-74-7: 2,3,5,6,8,9,11,12,14,15-decahydro-1,4,7,10,13,16-benzohexaoxacyclooctadecine-18-carbaldehyde
Description:The chemical substance known as "2,3,5,6,8,9,11,12,14,15-decahydro-1,4,7,10,13,16-benzohexaoxacyclooctadecine-18-carbaldehyde," with the CAS number 60835-74-7, is a complex organic compound characterized by its unique structure, which includes a benzohexaoxacyclooctadecine framework. This structure features multiple oxygen atoms integrated into a cyclic arrangement, contributing to its potential reactivity and solubility properties. The presence of the aldehyde functional group indicates that it can participate in various chemical reactions, such as oxidation and condensation. The compound's extensive hydrocarbon chain suggests it may exhibit hydrophobic characteristics, while the cyclic ether components could impart stability and influence its interaction with other molecules. Such compounds are often of interest in materials science and medicinal chemistry due to their potential applications in drug development and as intermediates in synthetic pathways. However, specific physical and chemical properties, such as melting point, boiling point, and solubility, would require empirical data for precise characterization.
Formula:C17H24O7
InChI:InChI=1/C17H24O7/c18-14-15-1-2-16-17(13-15)24-12-10-22-8-6-20-4-3-19-5-7-21-9-11-23-16/h1-2,13-14H,3-12H2
- Synonyms:
- 1,4,7,10,13,16-Benzohexaoxacyclooctadecin-18-Carboxaldehyde, 2,3,5,6,8,9,11,12,14,15-Decahydro-
- 2,3,5,6,8,9,11,12,14,15-Decahydro-1,4,7,10,13,16-benzohexaoxacyclooctadecine-18-carbaldehyde
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4'-Formylbenzo-18-crown 6-Ether REF: 3B-F0451CAS: 60835-74-7 | >98.0%(GC) | 1,111.00 € | Mon 28 Apr 25 |
![]() | 4-FORMYLBENZO-18-CROWN 6-ETHER REF: IN-DA003LGHCAS: 60835-74-7 | 95% | To inquire | Mon 05 May 25 |
![]() | 4'-Formylbenzo-18-crown 6-ether REF: 54-OR72921CAS: 60835-74-7 | 99% | 464.00 €~1,361.00 € | Tue 06 May 25 |
![]() | 4'-Formylbenzo-18-crown 6-Ether REF: 3D-FF62087CAS: 60835-74-7 | Min. 95% | - - - | Discontinued product |

4'-Formylbenzo-18-crown 6-Ether
Ref: 3B-F0451
500mg | 1,111.00 € |

4-FORMYLBENZO-18-CROWN 6-ETHER
Ref: IN-DA003LGH
1g | To inquire | ||
25mg | 149.00 € | ||
100mg | 292.00 € | ||
250mg | 592.00 € | ||
500mg | To inquire |

Ref: 54-OR72921
1g | 1,361.00 € | ||
100mg | 464.00 € | ||
250mg | 776.00 € |

4'-Formylbenzo-18-crown 6-Ether
Ref: 3D-FF62087
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |