CAS 60835-75-8
:4′-Carboxybenzo-18-crown-6
Description:
4′-Carboxybenzo-18-crown-6 is a member of the crown ether family, characterized by its ability to selectively bind cations due to its cyclic structure containing multiple ether linkages. This compound features a 18-membered ring that includes six ether oxygen atoms, which create a cavity suitable for coordinating with various metal ions, particularly alkali and alkaline earth metals. The presence of a carboxylic acid group at the para position of the benzo moiety enhances its solubility in polar solvents and can also participate in hydrogen bonding, influencing its binding properties. This compound is often utilized in supramolecular chemistry and analytical applications, such as ion-selective electrodes and extraction processes. Its ability to form stable complexes with cations makes it valuable in various fields, including environmental chemistry and materials science. Additionally, the structural features of 4′-Carboxybenzo-18-crown-6 allow for potential modifications, enabling the design of derivatives with tailored properties for specific applications.
Formula:C17H24O8
InChI:InChI=1S/C17H24O8/c18-17(19)14-1-2-15-16(13-14)25-12-10-23-8-6-21-4-3-20-5-7-22-9-11-24-15/h1-2,13H,3-12H2,(H,18,19)
InChI key:InChIKey=GFQYJVLOPVAPGJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C2C(=CC1)OCCOCCOCCOCCOCCO2
Synonyms:- 1,4,7,10,13,16-Benzohexaoxacyclooctadecin-18-Carboxylic Acid, 2,3,5,6,8,9,11,12,14,15-Decahydro-
- 2,3,5,6,8,9,11,12,14,15-Decahydro-1,4,7,10,13,16-Benzohexaoxacyclooctadecin-18-Carboxylic Acid
- 2,5,8,11,14,17-Hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carboxylic acid
- 4′-Carboxybenzo-18-crown-6
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4'-Carboxybenzo-18-crown 6-Ether
CAS:Formula:C17H24O8Purity:>97.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:356.372,3-(4-Carboxybenzo)-1,4,7,10,13,16-Hexaoxacyclooctadec-2-Ene
CAS:Formula:C17H24O8Purity:97%Color and Shape:SolidMolecular weight:356.36772,3-(4-Carboxybenzo)-1,4,7,10,13,16-hexaoxacyclooctadec-2-ene
CAS:2,3-(4-Carboxybenzo)-1,4,7,10,13,16-hexaoxacyclooctadec-2-enePurity:97%Molecular weight:356.37g/mol2,3,5,6,8,9,11,12,14,15-decahydrobenzo[b][1,4,7,10,13,16]hexaoxacyclooctadecine-18-carboxylicacid
CAS:Purity:97%Molecular weight:356.154'-Carboxybenzo-18-crown 6-ether
CAS:4'-Carboxybenzo-18-crown 6-ether is a fluorescent probe that can be used for the detection of water molecules. It has been used to detect the presence of carboxylate ions in urine samples and as an analytical chemistry reagent. The absorbance spectrum of 4'-carboxybenzo-18-crown 6-ether overlaps with the nmr spectra of potassium ion, which allows it to be used as a potassium ion detector. It has also been shown that this molecule is immobilized on surfaces by hydrogen bonding interactions.Formula:C17H24O8Purity:Min. 95%Color and Shape:PowderMolecular weight:356.37 g/molGUN35758
CAS:GUN35758 (4'-Carboxybenzo-18C6) is a novel transthyretin stabilizer with no formal name, inhibiting amyloidogenesis.Formula:C17H24O8Color and Shape:SolidMolecular weight:356.37





