CAS 60845-81-0
:Ethyl 2-(2-amino-4-thiazolyl)-2-(hydroxyimino)acetate
Description:
Ethyl 2-(2-amino-4-thiazolyl)-2-(hydroxyimino)acetate, with the CAS number 60845-81-0, is a chemical compound characterized by its unique structural features, which include a thiazole ring and a hydroxyimino functional group. This compound typically appears as a solid or crystalline substance and is soluble in polar solvents due to the presence of hydroxyl and amino groups. It is often studied for its potential biological activities, particularly in the fields of medicinal chemistry and pharmacology, where it may exhibit antimicrobial or antitumor properties. The thiazole moiety contributes to its reactivity and interaction with biological targets. Additionally, the ester functional group in ethyl acetate suggests that it may undergo hydrolysis under certain conditions, leading to the release of the corresponding acid and alcohol. Overall, this compound represents a class of bioactive molecules that can be further explored for their therapeutic applications and mechanisms of action in various biological systems.
Formula:C7H9N3O3S
InChI:InChI=1S/C7H9N3O3S/c1-2-13-6(11)5(10-12)4-3-14-7(8)9-4/h3,12H,2H2,1H3,(H2,8,9)
InChI key:InChIKey=BTEPYCPXBCCSDL-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(=NO)C=1N=C(N)SC1
Synonyms:- 4-Thiazoleacetic acid, 2-amino-α-(hydroxyimino)-, ethyl ester
- Ethyl (2-Amino-1,3-Thiazol-4-Yl)(Hydroxyimino)Acetate
- Ethyl 2-(2-amino-4-thiazolyl)-2-(hydroxyimino)acetate
- Ethyl 2-amino-alpha-(hydroxyimino)thiazol-4-acetate
- Ethyl 2-amino-α-(hydroxyimino)-4-thiazoleacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ethyl 2-(2-aminothiazole-4-yl)-2-hydroxyiminoacetate
CAS:Formula:C7H9N3O3SColor and Shape:SolidMolecular weight:215.2297Ethyl 2-(2-aminothiazole-4-yl)-2-hydroxyiminoacetate
CAS:<p>Ethyl 2-(2-aminothiazole-4-yl)-2-hydroxyiminoacetate</p>Formula:C7H9N3O3SPurity:≥95%Color and Shape: faint yellow powderMolecular weight:215.23g/molEthyl 2-(2-Amino-4-thiazolyl)-2-(hydroxyimino)acetate
CAS:<p>Ethyl 2-(2-amino-4-thiazolyl)-2-(hydroxyimino)acetate is a phosphomolybdate antibiotic that is used in the treatment of respiratory tract infections. It binds to the bacterial enzyme, phosphomolybdate oxidase, and inhibits the formation of acid in the body. The reaction solution is recycled and activated with an acid catalyst to increase the yield of acetonitrile. The ion-pair formed by ethyl 2-(2-amino-4-thiazolyl)-2-(hydroxyimino)acetate and sodium carbonate is nucleophilic and reacts with nitrous to produce acetonitrile as a side product.</p>Formula:C7H9N3O3SPurity:Min. 95%Molecular weight:215.23 g/mol


